Past Year QuestionsIPMAT Indore2022QA

IPMAT Indore 2022QA

All 40 QA previous year questions (PYQs) from the IPMAT Indore 2022 past year paper, with answers and full solutions.

Free SolutionsNo Login40 Questions
Q1:ipmat indore 2022QALogarithmsMediumSA · TITA
If log(x2)y+log(y2)x=1\log _{\left(x^{2}\right)} y+\log _{\left(y^{2}\right)} x=1 and y=x230y=x^{2}-30, then the value of x2+y2x^{2}+y^{2} is ___________.
Enter your answer to attempt
The Setup: We are given a logarithmic equation involving bases of x2x^2 and y2y^2, alongside a quadratic relation y=x230y=x^2-30. We must simplify the log equation to find xx and yy, then compute x2+y2x^2+y^2. Step 1: Simplify the logarithmic equation. Use the base power rule log(bk)a=1klogba\log_{(b^k)} a = \frac{1}{k} \log_b a: 12logxy+12logyx=1\frac{1}{2}\log_x y + \frac{1}{2}\log_y x = 1 Multiply by 2: logxy+logyx=2\log_x y + \log_y x = 2 Step 2: Solve for the relationship between xx and yy. Let a=logxya = \log_x y. By logarithmic inversion, logyx=1a\log_y x = \frac{1}{a}. a+1a=2a + \frac{1}{a} = 2 a22a+1=0    (a1)2=0    a=1a^2 - 2a + 1 = 0 \implies (a - 1)^2 = 0 \implies a = 1 Therefore, logxy=1\log_x y = 1, which strictly implies y=xy = x. Step 3: Apply the quadratic relation to find the valid coordinates. Substitute y=xy = x into the second equation y=x230y = x^2 - 30: x=x230    x2x30=0x = x^2 - 30 \implies x^2 - x - 30 = 0 Factor the quadratic: (x6)(x+5)=0    x=6 or x=5(x - 6)(x + 5) = 0 \implies x = 6 \text{ or } x = -5 Logarithmic bases (x2x^2 and y2y^2) and arguments (xx and yy) must be strictly positive, discarding x=5x = -5. Thus, x=6x = 6, and consequently y=6y = 6. Step 4: Calculate the final target expression. x2+y2=62+62=36+36=72x^2 + y^2 = 6^2 + 6^2 = 36 + 36 = 72 Final Answer: 72
Q2:ipmat indore 2022QAModulusMediumSA · TITA
The area enclosed by 2x+3y62|x|+3|y| \leq 6 is ____________ sq. units.
Enter your answer to attempt
The Setup: The inequality 2x+3y62|x| + 3|y| \le 6 forms a geometric shape (a rhombus) bounded by absolute value constraints. We must calculate its total enclosed area. Step 1: Find the intercepts of the boundary lines. Consider the boundary equation in the first quadrant where x0x \ge 0 and y0y \ge 0: 2x+3y=62x + 3y = 6 Find the xx-intercept (set y=0y = 0): 2x=6    x=32x = 6 \implies x = 3. Find the yy-intercept (set x=0x = 0): 3y=6    y=23y = 6 \implies y = 2. The vertices of the full rhombus across all four quadrants are (±3,0)(\pm 3, 0) and (0,±2)(0, \pm 2). Step 2: Calculate the area of the bounded shape. The area of a rhombus is given by 12×d1×d2\frac{1}{2} \times d_1 \times d_2, where d1d_1 and d2d_2 are the lengths of the diagonals. The horizontal diagonal connects (3,0)(-3, 0) to (3,0)(3, 0), so d1=6d_1 = 6. The vertical diagonal connects (0,2)(0, -2) to (0,2)(0, 2), so d2=4d_2 = 4. Area=12(6)(4)=12\text{Area} = \frac{1}{2} (6)(4) = 12 Final Answer: 12
Q3:ipmat indore 2022QATime, Speed & DistanceEasySA · TITA
When Geeta increases her speed from 1212 km/hr to 2020 km/hr, she takes one hour less than the usual time to cover the distance between her home and office. The distance between her home and office is ___________ km.
Enter your answer to attempt
The Setup: A speed increase from 12 km/hr12\text{ km/hr} to 20 km/hr20\text{ km/hr} results in a 11-hour time reduction to cover a fixed distance. We must build a time-difference equation to find the distance. Step 1: Formulate the time equation. Let dd be the fixed distance between the home and office. Time at normal speed = d12\frac{d}{12}. Time at increased speed = d20\frac{d}{20}. The difference between these times is exactly 11 hour: d12d20=1\frac{d}{12} - \frac{d}{20} = 1 Step 2: Solve for dd. Find a common denominator (6060) to combine the fractions: 5d603d60=1\frac{5d}{60} - \frac{3d}{60} = 1 2d60=1    d30=1    d=30\frac{2d}{60} = 1 \implies \frac{d}{30} = 1 \implies d = 30 Final Answer: 30
Q4:ipmat indore 2022QAPermutation & CombinationEasySA · TITA
The number of triangles that can be formed by choosing points from 7 points on a line and 5 points on another parallel line is _________.
Enter your answer to attempt
The Setup: We are choosing points to form triangles from two parallel lines containing 77 and 55 points respectively. Step 1: Identify the combinatorial cases for triangle formation. A triangle requires exactly 33 non-collinear vertices. Since the points lie on two parallel lines, taking 33 points from the same line is invalid. Thus, we must select either: * Case 1: 11 point from the first line and 22 points from the second line. * Case 2: 22 points from the first line and 11 point from the second line. Step 2: Calculate configurations for Case 1. Choose 11 point from the line with 77, and 22 points from the line with 55: Ways1=(71)×(52)=7×(5×42)=7×10=70\text{Ways}_1 = \binom{7}{1} \times \binom{5}{2} = 7 \times \left(\frac{5 \times 4}{2}\right) = 7 \times 10 = 70 Step 3: Calculate configurations for Case 2. Choose 22 points from the line with 77, and 11 point from the line with 55: Ways2=(72)×(51)=(7×62)×5=21×5=105\text{Ways}_2 = \binom{7}{2} \times \binom{5}{1} = \left(\frac{7 \times 6}{2}\right) \times 5 = 21 \times 5 = 105 Step 4: Sum the valid triangle configurations. Total Triangles=70+105=175\text{Total Triangles} = 70 + 105 = 175 Final Answer: 175
Q5:ipmat indore 2022QAProfit & LossMediumSA · TITA
Aruna purchases a certain number of apples for INR 20 each and a certain number of mangoes for INR 25 each. If she sells all the apples at 10%10 \% profit and all the mangoes at 20%20 \% loss, overall she makes neither profit nor loss. Instead, if she sells all the apples at 20%20 \% loss and all the mangoes at 10%10 \% profit, overall she makes a loss of INR 150. Then the number of apples purchased by Aruna is _________.
Enter your answer to attempt
The Setup: We have a system of profit/loss constraints across two different scenarios for an unknown quantity of apples and mangoes with fixed unit costs. We must solve the linear equations to find the exact number of apples. Step 1: Define variables and calculate per-item cost variations. Let AA be the number of apples (Cost = 2020 each). Let MM be the number of mangoes (Cost = 2525 each). * +10%+10\% on apples = +2+2 profit per apple. * 20%-20\% on mangoes = 5-5 loss per mango. * 20%-20\% on apples = 4-4 loss per apple. * +10%+10\% on mangoes = +2.5+2.5 profit per mango. Step 2: Formulate Scenario 1 to find the quantity ratio. In the first scenario, the net profit is exactly 00: 2A5M=0    2A=5M    M=0.4A2A - 5M = 0 \implies 2A = 5M \implies M = 0.4A Step 3: Formulate Scenario 2 to solve for AA. In the second scenario, the net loss is 150150 (meaning profit is 150-150): 4A+2.5M=150-4A + 2.5M = -150 Multiply by 1-1 for clarity: 4A2.5M=1504A - 2.5M = 150 Step 4: Substitute the ratio and calculate AA. Substitute M=0.4AM = 0.4A into the second equation: 4A2.5(0.4A)=1504A - 2.5(0.4A) = 150 4A1A=1504A - 1A = 150 3A=150    A=503A = 150 \implies A = 50 Final Answer: 50
Q6:ipmat indore 2022QAModulusMediumSA · TITA
Given that f(x)=x+2x1+x2+x4+x6+2x10,x(,)f(x)=|x|+2|x-1|+|x-2|+|x-4|+|x-6|+2|x-10|, x \in(-\infty, \infty) the minimum value of f(x)f(x) is _________.
Enter your answer to attempt
The Setup: We must find the minimum value of a sum of absolute value functions f(x)=x+2x1+x2+x4+x6+2x10f(x)=|x|+2|x-1|+|x-2|+|x-4|+|x-6|+2|x-10|. Step 1: Translate the function into a median problem. The minimum value of a sum of absolute deviations cixai\sum c_i |x - a_i| occurs at the median of the data points aia_i, weighted by their frequencies cic_i. List out the points based on their respective coefficients: * 00 (Frequency 1) * 11 (Frequency 2) * 22 (Frequency 1) * 44 (Frequency 1) * 66 (Frequency 1) * 1010 (Frequency 2) The complete ordered data set contains 88 points: {0,1,1,2,4,6,10,10}\{0, 1, 1, 2, 4, 6, 10, 10\}. Step 2: Identify the median of the set. Since there is an even number of data points (n=8n=8), the minimum is achieved anywhere along the interval between the 4th and 5th values. The 4th point is 22 and the 5th point is 44. Any x[2,4]x \in [2, 4] minimizes f(x)f(x). Step 3: Calculate the minimum value f(x)f(x). Substitute any value from the valid interval (e.g., x=2x = 2) into f(x)f(x): f(2)=20+221+22+24+26+2210f(2) = |2-0| + 2|2-1| + |2-2| + |2-4| + |2-6| + 2|2-10| f(2)=2+2(1)+0+2+4+28f(2) = 2 + 2(1) + 0 + |-2| + |-4| + 2|-8| f(2)=2+2+0+2+4+16=26f(2) = 2 + 2 + 0 + 2 + 4 + 16 = 26 Final Answer: 26
Q7:ipmat indore 2022QAMatrices & DeterminantsMediumSA · TITA
If A=[100001010]A=\left[\begin{array}{lll}1 & 0 & 0 \\ 0 & 0 & 1 \\ 0 & 1 & 0\end{array}\right], then the absolute value of the determinant of (A9+A6+A3+A)\left(A^{9}+A^{6}+A^{3}+A\right) is __________.
Enter your answer to attempt
The Setup: A specific permutation matrix AA is given. We must establish the cyclical property of its powers to evaluate the absolute determinant of a matrix polynomial (A9+A6+A3+A)(A^9+A^6+A^3+A). Step 1: Establish the power cycle of Matrix AA. A=[100001010]A = \begin{bmatrix}1&0&0\\0&0&1\\0&1&0\end{bmatrix} Calculate A2A^2: A2=[100001010][100001010]=[100010001]=IA^2 = \begin{bmatrix}1&0&0\\0&0&1\\0&1&0\end{bmatrix} \begin{bmatrix}1&0&0\\0&0&1\\0&1&0\end{bmatrix} = \begin{bmatrix}1&0&0\\0&1&0\\0&0&1\end{bmatrix} = I Since A2=IA^2 = I, the powers of AA alternate: odd powers yield AA, and even powers yield the Identity matrix II. Step 2: Simplify the matrix polynomial. The expression is A9+A6+A3+AA^9 + A^6 + A^3 + A. Apply the parity rules: * A9=AA^9 = A (odd) * A6=IA^6 = I (even) * A3=AA^3 = A (odd) * A=AA = A (odd) Sum Matrix=A+I+A+A=3A+I\text{Sum Matrix} = A + I + A + A = 3A + I Step 3: Construct the elements of the final matrix. 3A=[300003030]3A = \begin{bmatrix}3&0&0\\0&0&3\\0&3&0\end{bmatrix} Add the Identity matrix II: 3A+I=[400013031]3A + I = \begin{bmatrix}4&0&0\\0&1&3\\0&3&1\end{bmatrix} Step 4: Calculate the determinant. Expand along the top row: det(3A+I)=4(1×13×3)=4(19)=4(8)=32\det(3A+I) = 4(1 \times 1 - 3 \times 3) = 4(1 - 9) = 4(-8) = -32 The absolute value of the determinant is 32=32|-32| = 32. Final Answer: 32
Q8:ipmat indore 2022QABinomial TheoremEasySA · TITA
The sum of the coefficients of all the terms in the expansion of (5x9)4(5 x-9)^{4} is __________.
Enter your answer to attempt
The Setup: We are asked to find the arithmetic sum of the coefficients of all terms within the binomial expansion of (5x9)4(5x-9)^4. Step 1: Apply the polynomial coefficient property. For any polynomial P(x)P(x), the sum of its fully expanded coefficients is mathematically obtained by evaluating the polynomial at x=1x = 1. Step 2: Evaluate the expression at x=1x = 1. P(1)=(5(1)9)4P(1) = (5(1) - 9)^4 P(1)=(59)4P(1) = (5 - 9)^4 P(1)=(4)4P(1) = (-4)^4 P(1)=256P(1) = 256 Final Answer: 256
Q9:ipmat indore 2022QAProgression & SeriesMediumSA · TITA
A new sequence is obtained from the sequence of positive integers (1,2,3,)(1,2,3, \ldots) by deleting all the perfect squares. Then the 2022nd 2022^{\text {nd }} term of the new sequence is ________.
Enter your answer to attempt
The Setup: A sequence of positive integers removes all perfect squares. We must determine the numerical value of the 2022nd2022^{\text{nd}} remaining integer in this sequence. Step 1: Establish the formula for sequence terms. Let NN be the actual value of the term. The sequence loses one position for every perfect square it passes. The number of perfect squares less than or equal to NN is N\lfloor\sqrt{N}\rfloor. Thus, the position of NN in the modified sequence is given by: NN=2022N - \lfloor\sqrt{N}\rfloor = 2022. Step 2: Estimate NN to find bounds. Because NN will be slightly larger than 20222022, we estimate N2022\sqrt{N} \approx \sqrt{2022}. 442=193644^2 = 1936 and 452=202545^2 = 2025. Therefore, the square root will be bounded by approximately 4545. Step 3: Test the logical value for NN. Add our 4545 estimated skipped squares to the 2022nd2022^{\text{nd}} position: Let's test N=2022+45=2067N = 2022 + 45 = 2067. Check how many perfect squares exist up to 20672067: The largest integer square less than 20672067 is 452=202545^2 = 2025. Thus, exactly 4545 squares are skipped. Subtract the skipped squares to verify the position: Position=206745=2022\text{Position} = 2067 - 45 = 2022 The number 20672067 precisely lands on the 2022nd2022^{\text{nd}} position, and it is not itself a perfect square, so it genuinely survives into the new sequence. Step 4: Confirm the answer is unique. The counting function NNN - \lfloor\sqrt{N}\rfloor never decreases as NN grows, so it takes the value 20222022 on at most one non-square NN. Hence 20672067 is the only possibility. Final Answer: 2067
Q10:ipmat indore 2022QATrigonometryHardSA · TITA
If sinα+sinβ=23\sin \alpha+\sin \beta=\frac{\sqrt{2}}{\sqrt{3}} and cosα+cosβ=13\cos \alpha+\cos \beta=\frac{1}{\sqrt{3}}, then the value of (20cos(αβ2))2\left(20 \cos \left(\frac{\alpha-\beta}{2}\right)\right)^{2} is _________.
Enter your answer to attempt
The Setup: We are given constraint equations sinα+sinβ=23\sin\alpha+\sin\beta = \frac{\sqrt{2}}{\sqrt{3}} and cosα+cosβ=13\cos\alpha+\cos\beta = \frac{1}{\sqrt{3}}. We need to evaluate the compound trigonometric expression (20cos(αβ2))2\left(20\cos\left(\frac{\alpha-\beta}{2}\right)\right)^2. Step 1: Square and add the two primary equations. Equation 1: (sinα+sinβ)2=(23)2    sin2α+sin2β+2sinαsinβ=23(\sin\alpha+\sin\beta)^2 = \left(\frac{\sqrt{2}}{\sqrt{3}}\right)^2 \implies \sin^2\alpha + \sin^2\beta + 2\sin\alpha\sin\beta = \frac{2}{3} Equation 2: (cosα+cosβ)2=(13)2    cos2α+cos2β+2cosαcosβ=13(\cos\alpha+\cos\beta)^2 = \left(\frac{1}{\sqrt{3}}\right)^2 \implies \cos^2\alpha + \cos^2\beta + 2\cos\alpha\cos\beta = \frac{1}{3} Summing them together: (sin2α+cos2α)+(sin2β+cos2β)+2(cosαcosβ+sinαsinβ)=23+13(\sin^2\alpha + \cos^2\alpha) + (\sin^2\beta + \cos^2\beta) + 2(\cos\alpha\cos\beta + \sin\alpha\sin\beta) = \frac{2}{3} + \frac{1}{3} Using Pythagorean and subtraction identities: 1+1+2cos(αβ)=1    2+2cos(αβ)=11 + 1 + 2\cos(\alpha-\beta) = 1 \implies 2 + 2\cos(\alpha-\beta) = 1 Step 2: Relate the expression to the half-angle formula. Factor out the 22: 2(1+cos(αβ))=12(1 + \cos(\alpha-\beta)) = 1 Apply the power-reduction identity 1+cosθ=2cos2(θ2)1 + \cos\theta = 2\cos^2\left(\frac{\theta}{2}\right): 2(2cos2(αβ2))=12 \left(2\cos^2\left(\frac{\alpha-\beta}{2}\right)\right) = 1 4cos2(αβ2)=14\cos^2\left(\frac{\alpha-\beta}{2}\right) = 1 Step 3: Evaluate the target expression. The target is (20cos(αβ2))2\left(20\cos\left(\frac{\alpha-\beta}{2}\right)\right)^2. Expand the target: 400cos2(αβ2)400\cos^2\left(\frac{\alpha-\beta}{2}\right) Substitute the derived identity block: 100×[4cos2(αβ2)]=100×1=100100 \times \left[4\cos^2\left(\frac{\alpha-\beta}{2}\right)\right] = 100 \times 1 = 100 Final Answer: 100
Q11:ipmat indore 2022QAProgression & SeriesMediumSA · TITA
The 3rd ,14th 3^{\text {rd }}, 14^{\text {th }} and 69th 69^{\text {th }} terms of an arithmetic progression form three distinct and consecutive terms of a geometric progression. If the next term of the geometric progression is the nth n^{\text {th }} term of the arithmetic progression, then nn equals ________.
Enter your answer to attempt
The Setup: Three selected terms (3rd,14th,69th3^{\text{rd}}, 14^{\text{th}}, 69^{\text{th}}) of an Arithmetic Progression (AP) form a separate Geometric Progression (GP). The 4th term of this GP corresponds to the nthn^{\text{th}} term of the AP. We must find index nn. Step 1: Establish the GP relationship. Let the AP have a first term aa and common difference dd. T3=a+2dT_3 = a + 2d T14=a+13dT_{14} = a + 13d T69=a+68dT_{69} = a + 68d Because these form a GP, the square of the middle term equals the product of the outer terms: (a+13d)2=(a+2d)(a+68d)(a + 13d)^2 = (a + 2d)(a + 68d) a2+26ad+169d2=a2+70ad+136d2a^2 + 26ad + 169d^2 = a^2 + 70ad + 136d^2 Step 2: Relate the starting term to the difference. 33d2=44ad33d^2 = 44ad Assuming d0d \neq 0 (otherwise all terms are identical and limits break), divide by 11d11d: 3d=4a    a=34d3d = 4a \implies a = \frac{3}{4}d Step 3: Calculate the GP common ratio. Substitute a=0.75da = 0.75d into the first two terms of the GP: T3=0.75d+2d=2.75d=114dT_3 = 0.75d + 2d = 2.75d = \frac{11}{4}d T14=0.75d+13d=13.75d=554dT_{14} = 0.75d + 13d = 13.75d = \frac{55}{4}d The common ratio r=T14T3=55/411/4=5r = \frac{T_{14}}{T_3} = \frac{55/4}{11/4} = 5. The third term is T69=0.75d+68d=68.75d=2754dT_{69} = 0.75d + 68d = 68.75d = \frac{275}{4}d. (Verified: 554d×5=2754d\frac{55}{4}d \times 5 = \frac{275}{4}d). Step 4: Calculate the next GP term and map it to the AP index. The 4th GP term is T69×rT_{69} \times r: Next GP Term=2754d×5=13754d\text{Next GP Term} = \frac{275}{4}d \times 5 = \frac{1375}{4}d Set this equal to the generic nthn^{\text{th}} term of the AP (a+(n1)da + (n-1)d): 34d+(n1)d=13754d\frac{3}{4}d + (n-1)d = \frac{1375}{4}d (n1)d=13724d    n1=343    n=344(n-1)d = \frac{1372}{4}d \implies n-1 = 343 \implies n = 344 Final Answer: 344
Q12:ipmat indore 2022QASet TheoryEasySA · TITA
Let P(X)P(X) denote power set of a set XX. If AA is the null set, then the number of elements in P(P(P(P(A))))P(P(P(P(A)))) is _________.
Enter your answer to attempt
The Setup: We need to compute the total number of elements generated through four successive iterations of the power set operation P(X)P(X), starting with a null set AA. Step 1: Track the set cardinality through each power set iteration. The cardinality property dictates that if a set XX has kk elements, its power set P(X)P(X) will have 2k2^k elements. * Iteration 0: The set AA is a null set. A=0|A| = 0. * Iteration 1: P(A)=20=1|P(A)| = 2^0 = 1. * Iteration 2: P(P(A))=21=2|P(P(A))| = 2^1 = 2. * Iteration 3: P(P(P(A)))=22=4|P(P(P(A)))| = 2^2 = 4. * Iteration 4: P(P(P(P(A))))=24=16|P(P(P(P(A))))| = 2^4 = 16. Final Answer: 16
Q13:ipmat indore 2022QAProgression & SeriesMediumSA · TITA
The numbers 16,2x+322x116,22x1+16-16,2^{x+3}-2^{2 x-1}-16,2^{2 x-1}+16 are in an arithmetic progression. Then xx equals ________.
Enter your answer to attempt
The Setup: Three expressions involving exponential powers of 22 and constants are given as consecutive terms of an Arithmetic Progression. We must solve for the unknown exponent xx. Step 1: Establish the arithmetic mean equation. For three terms A,B,CA, B, C in an AP, 2B=A+C2B = A + C. Given terms: A=16A = -16, B=2x+322x116B = 2^{x+3} - 2^{2x-1} - 16, and C=22x1+16C = 2^{2x-1} + 16. 2(2x+322x116)=16+(22x1+16)2(2^{x+3} - 2^{2x-1} - 16) = -16 + (2^{2x-1} + 16) Step 2: Simplify the algebraic constraints. 22x+3222x132=22x12 \cdot 2^{x+3} - 2 \cdot 2^{2x-1} - 32 = 2^{2x-1} Combine the exponential terms: 2x+422x32=22x12^{x+4} - 2^{2x} - 32 = 2^{2x-1} Group the terms involving 2x2x on the right: 2x+432=22x1+22x2^{x+4} - 32 = 2^{2x-1} + 2^{2x} Factor out 22x2^{2x}: 2x+432=22x(12+1)=3222x2^{x+4} - 32 = 2^{2x} \left(\frac{1}{2} + 1\right) = \frac{3}{2} \cdot 2^{2x} Step 3: Use substitution to solve the resulting quadratic. Let y=2xy = 2^x. Then 2x+4=16y2^{x+4} = 16y, and 22x=y22^{2x} = y^2. 16y32=32y216y - 32 = \frac{3}{2}y^2 Multiply by 22 and rearrange into standard quadratic form: 3y232y+64=03y^2 - 32y + 64 = 0 Factor the quadratic equation: (3y8)(y8)=0(3y - 8)(y - 8) = 0 Step 4: Evaluate valid roots for integer xx. This yields y=8/3y = 8/3 or y=8y = 8. Since y=2xy = 2^x, resolving for y=8y = 8 yields 2x=8    x=32^x = 8 \implies x = 3. *(The fractional root y=8/3y=8/3 yields an irrational logarithmic decimal out of scope for standard numeric data entry).* Final Answer: 3
Q14:ipmat indore 2022QAPermutation & CombinationMediumSA · TITA
Mrs and Mr Sharma, and Mrs and Mr Ahuja along with four other persons are to be seated at a round table for dinner. If Mrs and Mr Sharma are to be seated next to each other, and Mrs and Mr Ahuja are not to be seated next to each other, then the total number of seating arrangements is _________.
Enter your answer to attempt
The Setup: A combinatorics problem where 8 individuals are arranged at a round table. We apply circular permutation blocks and complementary counting to satisfy simultaneous grouping constraints (one pair together, one pair separated). Step 1: Calculate permutations satisfying the first constraint. Total people = 8. Constraint 1: The Sharma pair must sit together. Bind the Sharmas into a single block. We now have 7 distinct entities to arrange in a circle (the Sharma block + 6 others). Circular arrangements=(n1)!=(71)!=6!\text{Circular arrangements} = (n-1)! = (7-1)! = 6! The Sharmas can also swap seats internally within their block (2!2!). Total ways (Sharmas together)=6!×2=720×2=1440\text{Total ways (Sharmas together)} = 6! \times 2 = 720 \times 2 = 1440 Step 2: Calculate overlapping violations (both pairs together). Constraint 2: The Ahuja pair must NOT sit together. We find the restricted subset where they *do* sit together to subtract it from our total. Bind the Sharmas into one block and the Ahujas into another block. We now have 6 distinct entities to arrange. Circular arrangements=(61)!=5!\text{Circular arrangements} = (6-1)! = 5! Both the Sharma block and the Ahuja block have internal swaps (2!×2!2! \times 2!). Ways (Both pairs together)=5!×2×2=120×4=480\text{Ways (Both pairs together)} = 5! \times 2 \times 2 = 120 \times 4 = 480 Step 3: Apply complementary counting. Subtract the violating cases from the initial grouping constraints: Valid Seating=(Sharmas together)(Both pairs together)\text{Valid Seating} = (\text{Sharmas together}) - (\text{Both pairs together}) Valid Seating=1440480=960\text{Valid Seating} = 1440 - 480 = 960 Final Answer: 960
Q15:ipmat indore 2022QAMean, Median & ModeMediumSA · TITA
Let 50 distinct positive integers be chosen such that the highest among them is 100, and the average of the largest 25 integers among them exceeds the average of the remaining integers by 50. Then the maximum possible value of the sum of all the 50 integers is _________.
Enter your answer to attempt
The Setup: We are asked to maximize the total sum of 5050 distinct positive integers bounded by 100100. The average of the top 2525 integers is rigidly offset 5050 units above the average of the bottom 2525 integers. Step 1: Translate the average constraint into sum parameters. Let SLS_L be the sum of the largest 2525 integers, and SSS_S be the sum of the remaining (smallest) 2525 integers. Average(SL)Average(SS)=50\text{Average}(S_L) - \text{Average}(S_S) = 50 SL25SS25=50    SLSS=1250\frac{S_L}{25} - \frac{S_S}{25} = 50 \implies S_L - S_S = 1250 The goal is to maximize the grand total sum: SL+SSS_L + S_S. Step 2: Express the objective strictly in terms of SLS_L. Rearranging the constraint yields SS=SL1250S_S = S_L - 1250. Total Sum=SL+(SL1250)=2SL1250\text{Total Sum} = S_L + (S_L - 1250) = 2S_L - 1250 To maximize the Total Sum, we strictly need to maximize the component SLS_L. Step 3: Maximize SLS_L using number properties. The set consists of strictly distinct positive integers with a ceiling of 100100. To maximize SLS_L (the sum of the 25 largest items), we pick the absolute highest available discrete integers descending from 100100: {100,99,98,,76}\{100, 99, 98, \dots, 76\}. Using the arithmetic series sum formula: SL=n2(a1+an)=252(100+76)=25×88=2200S_L = \frac{n}{2}(a_1 + a_n) = \frac{25}{2}(100 + 76) = 25 \times 88 = 2200 Step 4: Verify the lower boundary SSS_S is physically viable. With SL=2200S_L = 2200, the forced offset calculates SS=22001250=950S_S = 2200 - 1250 = 950. We must verify if 2525 distinct integers smaller than 7676 can legitimately sum to 950950. The absolute minimum sum of 2525 distinct positive integers is 1+2++25=3251 + 2 + \dots + 25 = 325. The largest such sum is 51+52++75=157551 + 52 + \dots + 75 = 1575. Because 3259501575325 \le 950 \le 1575, the required SSS_S sits inside the achievable range. An explicit set works: {26,27,,50}\{26, 27, \dots, 50\} consists of 2525 distinct integers, all below 7676, and sums to 252(26+50)=25×38=950\frac{25}{2}(26 + 50) = 25 \times 38 = 950. So the configuration is genuinely realisable, not merely arithmetically consistent. Step 5: Compute the final maximum total. Max Total Sum=SL+SS=2200+950=3150\text{Max Total Sum} = S_L + S_S = 2200 + 950 = 3150 Final Answer: 3150
Q16:ipmat indore 2022QATrigonometryHardMCQ · MCQ
For 0<θ<π40\lt\theta\lt\frac{\pi}{4}, let a=((sinθ)sinθ)(log2cosθ),b=((cosθ)sinθ)(log2sinθ),c=((sinθ)cosθ)(log2cosθ)a=\left((\sin \theta)^{\sin \theta}\right)\left(\log _{2} \cos \theta\right), b=\left((\cos \theta)^{\sin \theta}\right)\left(\log _{2} \sin \theta\right), c=\left((\sin \theta)^{\cos \theta}\right)\left(\log _{2} \cos \theta\right) and d=((sinθ)sinθ)(log2sinθ)d=\left((\sin \theta)^{\sin \theta}\right)\left(\log _{2} \sin \theta\right). Then, the median value in the sequence a,b,c,da, b, c, d is
  • Aa+b2\frac{a+b}{2}
  • Ba+d2\frac{a+d}{2}
  • Cb+c2\frac{b+c}{2}
  • Dc+d2\frac{c+d}{2}
Pick an option to attempt
The Setup: We are asked to order four logarithmic-exponential expressions to find their median. By analyzing the base and arguments within the interval 0<θ<π/40 < \theta < \pi/4, we can determine their strict mathematical ordering. Step 1: Analyze the components within the given domain. For θ(0,π/4)\theta \in (0, \pi/4), the sine and cosine functions are bounded such that: 0<sinθ<12<cosθ<10 < \sin\theta < \frac{1}{\sqrt{2}} < \cos\theta < 1 Because both sinθ\sin\theta and cosθ\cos\theta are strictly between 00 and 11, their base-22 logarithms are strictly negative: log2(sinθ)<log2(cosθ)<0\log_2(\sin\theta) < \log_2(\cos\theta) < 0 Step 2: Compare the components of expressions a,b,c,da, b, c, d. The definitions are: a=(sinθ)sinθlog2(cosθ)a = (\sin\theta)^{\sin\theta} \log_2(\cos\theta) b=(cosθ)sinθlog2(sinθ)b = (\cos\theta)^{\sin\theta} \log_2(\sin\theta) c=(sinθ)cosθlog2(cosθ)c = (\sin\theta)^{\cos\theta} \log_2(\cos\theta) d=(sinθ)sinθlog2(sinθ)d = (\sin\theta)^{\sin\theta} \log_2(\sin\theta) Notice that all four overall expressions yield negative values (a positive exponential multiplied by a negative logarithm). Step 3: Establish the inequalities. First, compare aa and cc: Since sinθ<cosθ\sin\theta < \cos\theta and the base sinθ(0,1)\sin\theta \in (0, 1), a larger exponent yields a smaller value: (sinθ)cosθ<(sinθ)sinθ(\sin\theta)^{\cos\theta} < (\sin\theta)^{\sin\theta} Because log2(cosθ)\log_2(\cos\theta) is negative, multiplying both sides by it reverses the inequality: (sinθ)cosθlog2(cosθ)>(sinθ)sinθlog2(cosθ)    c>a(\sin\theta)^{\cos\theta} \log_2(\cos\theta) > (\sin\theta)^{\sin\theta} \log_2(\cos\theta) \implies c > a Second, compare bb and dd: Because sinθ<cosθ\sin\theta < \cos\theta, raising them to the positive power of sinθ\sin\theta preserves the inequality: (sinθ)sinθ<(cosθ)sinθ(\sin\theta)^{\sin\theta} < (\cos\theta)^{\sin\theta} Because log2(sinθ)\log_2(\sin\theta) is negative, multiplying reverses the inequality: (sinθ)sinθlog2(sinθ)>(cosθ)sinθlog2(sinθ)    d>b(\sin\theta)^{\sin\theta} \log_2(\sin\theta) > (\cos\theta)^{\sin\theta} \log_2(\sin\theta) \implies d > b Third, compare aa and dd: They share the identical positive exponential factor (sinθ)sinθ(\sin\theta)^{\sin\theta}. Since log2(sinθ)<log2(cosθ)\log_2(\sin\theta) < \log_2(\cos\theta), multiplying by the positive exponential preserves the inequality: d<ad < a Step 4: Determine the median. Combining the inequalities gives the strict ascending order: b<d<a<cb < d < a < c. For a set of 4 elements, the median is the arithmetic mean of the two central terms (dd and aa). Median=a+d2\text{Median} = \frac{a + d}{2} Final Answer: a+d2\frac{a+d}{2}
Q17:ipmat indore 2022QALogarithmsMediumMCQ · MCQ
The set of real values of xx for which the inequality log278log3x<91log23\log _{27} 8 \leq \log _{3} x \lt 9^{\frac{1}{\log _{2} 3}} holds is
  • A[2,81)[2,81)
  • B(2,27)(2,27)
  • C[2,81][2,81]
  • D(2,27](2,27]
Pick an option to attempt
The Setup: We are given a compound logarithmic inequality: log278log3x<91/log23\log_{27}8 \le \log_3 x < 9^{1/\log_2 3}. We must simplify the bounds to isolate xx. Step 1: Simplify the lower bound. log278=log3323\log_{27} 8 = \log_{3^3} 2^3 Using the exponent rule logbkap=pklogba\log_{b^k} a^p = \frac{p}{k} \log_b a: log278=33log32=log32\log_{27} 8 = \frac{3}{3} \log_3 2 = \log_3 2 Step 2: Simplify the upper bound. Use the base-change inversion rule 1logab=logba\frac{1}{\log_a b} = \log_b a: 91/log23=9log329^{1/\log_2 3} = 9^{\log_3 2} Rewrite the base 99 as 323^2: (32)log32=32log32=3log3(22)=3log34(3^2)^{\log_3 2} = 3^{2 \log_3 2} = 3^{\log_3(2^2)} = 3^{\log_3 4} By the fundamental log identity blogbk=kb^{\log_b k} = k, this equals 44. Step 3: Solve the resulting inequality for xx. Substitute the simplified bounds back into the original inequality: log32log3x<4\log_3 2 \le \log_3 x < 4 Since the logarithmic base 33 is greater than 11, the function is strictly increasing, meaning we can safely exponentiate all parts by base 33 without flipping signs: 3log323log3x<343^{\log_3 2} \le 3^{\log_3 x} < 3^4 2x<812 \le x < 81 Final Answer: [2,81)[2,81)
Q18:ipmat indore 2022QAFunctionsMediumMCQ · MCQ
The set of all possible values of f(x)f(x) for which (81)x+(81)f(x)=3(81)^{x}+(81)^{f(x)}=3 is
  • A(0.25,3)0.25,3)
  • B(,4)(-\infty, 4)
  • C(,0.25)(-\infty, 0.25)
  • D(3,4)(3,4)
Pick an option to attempt
The Setup: Given the equation 81x+81f(x)=381^x + 81^{f(x)} = 3, we need to determine the complete set of possible values for the output of the function f(x)f(x). Step 1: Isolate the term containing f(x)f(x). 81f(x)=381x81^{f(x)} = 3 - 81^x Step 2: Analyze the domain and range constraints. For any real number xx, an exponential function with a positive base is strictly positive: 81x>081^x > 0. Since 81f(x)81^{f(x)} is also strictly positive, its equal counterpart must be positive: 381x>0    81x<33 - 81^x > 0 \implies 81^x < 3 Because 81x81^x is strictly bounded between 00 and 33, the expression (381x)(3 - 81^x) maps continuously across the open interval (0,3)(0, 3). Step 3: Translate the range to f(x)f(x). Because 81f(x)=381x81^{f(x)} = 3 - 81^x, the function 81f(x)81^{f(x)} takes all values in the interval (0,3)(0, 3). 0<81f(x)<30 < 81^{f(x)} < 3 The lower bound 0<81f(x)0 < 81^{f(x)} holds true for all real values of f(x)f(x) (an exponential function has no lower limit restriction other than 00). Solve the upper bound: 81f(x)<3    (34)f(x)<31    34f(x)<3181^{f(x)} < 3 \implies (3^4)^{f(x)} < 3^1 \implies 3^{4f(x)} < 3^1 Because base 3>13 > 1, we can equate the exponents directly: 4f(x)<1    f(x)<0.254f(x) < 1 \implies f(x) < 0.25 Thus, f(x)f(x) covers all real numbers strictly less than 0.250.25. Final Answer: (,0.25)(-\infty, 0.25)
Q19:ipmat indore 2022QATrigonometryMediumMCQ · MCQ
Ayesha is standing atop a vertical tower 200m200 m high and observes a car moving away from the tower on a straight, horizontal road from the foot of the tower. At 11:00 AM, she observes the angle of depression of the car to be 4545^{\circ}. At 11:02 AM, she observes the angle of depression of the car to be 3030^{\circ}. The speed at which the car is moving is approximately
  • A6.3 km per hour
  • B8.45 km per hour
  • C10.6 km per hour
  • D4.39 km per hour
Pick an option to attempt
The Setup: A car is tracked from a 200m200\text{m} tower. Its angle of depression changes from 4545^\circ to 3030^\circ over exactly 22 minutes. We must use right-triangle trigonometry to find its speed in km/h\text{km/h}. Step 1: Calculate the initial horizontal distance. Let the tower base be the origin. At 11:00 AM, the angle of depression is 4545^\circ. Using trigonometry, tan(45)=HeightDistance1\tan(45^\circ) = \frac{\text{Height}}{\text{Distance}_1}. 1=200d1    d1=200 meters1 = \frac{200}{d_1} \implies d_1 = 200\text{ meters} Step 2: Calculate the subsequent horizontal distance. At 11:02 AM, the angle of depression is 3030^\circ. tan(30)=HeightDistance2\tan(30^\circ) = \frac{\text{Height}}{\text{Distance}_2} 13=200d2    d2=2003 meters\frac{1}{\sqrt{3}} = \frac{200}{d_2} \implies d_2 = 200\sqrt{3}\text{ meters} Step 3: Calculate the distance traveled. The distance the car traveled in the 2-minute interval is the difference: Δd=d2d1=2003200=200(31)\Delta d = d_2 - d_1 = 200\sqrt{3} - 200 = 200(\sqrt{3} - 1) Using the approximation 31.732\sqrt{3} \approx 1.732: Δd200(1.7321)=200(0.732)=146.4 meters\Delta d \approx 200(1.732 - 1) = 200(0.732) = 146.4\text{ meters} Step 4: Calculate the speed in km/h. The car traveled 146.4146.4 meters in 22 minutes. Speed=146.4 meters2 minutes=73.2 meters/minute\text{Speed} = \frac{146.4\text{ meters}}{2\text{ minutes}} = 73.2\text{ meters/minute} Convert to kilometers per hour (×60 minutes/hour,÷1000 meters/km\times 60 \text{ minutes/hour}, \div 1000 \text{ meters/km}): Speed=73.2×601000=43921000=4.392 km/h\text{Speed} = \frac{73.2 \times 60}{1000} = \frac{4392}{1000} = 4.392\text{ km/h} Final Answer: 4.39 km per hour
Q20:ipmat indore 2022QAStraight LinesMediumMCQ · MCQ
The value of kk for which the following lines are concurrent is xy1=02x+3y12=02x3y+k=0x-y-1=0 \newline 2x+3y-12=0 \newline 2x-3y+k=0
  • A1
  • B-1
  • C0
  • D12
Pick an option to attempt
The Setup: Three straight lines are concurrent (they intersect at a single unified point). We must find the intersection of the first two lines and use it to solve for the missing constant kk in the third line. Step 1: Find the intersection point of the first two lines. Line 1: xy1=0    x=y+1x - y - 1 = 0 \implies x = y + 1 Line 2: 2x+3y12=02x + 3y - 12 = 0 Substitute xx into the second equation: 2(y+1)+3y12=02(y + 1) + 3y - 12 = 0 2y+2+3y12=02y + 2 + 3y - 12 = 0 5y10=0    y=25y - 10 = 0 \implies y = 2 Substitute yy back to find xx: x=2+1=3x = 2 + 1 = 3 The shared intersection point is (3,2)(3, 2). Step 2: Solve for kk. For the three lines to be perfectly concurrent, Line 3 (2x3y+k=02x - 3y + k = 0) must also pass precisely through (3,2)(3, 2). Substitute x=3x = 3 and y=2y = 2 into the third equation: 2(3)3(2)+k=02(3) - 3(2) + k = 0 66+k=0    k=06 - 6 + k = 0 \implies k = 0 Final Answer: 0
Q21:ipmat indore 2022QAModulusMediumMCQ · MCQ
The sum of the squares of all the roots of the equation x2+x+4+x435=0x^{2}+|x+4|+|x-4|-35=0 is
  • A74
  • B175
  • C50
  • D148
Pick an option to attempt
The Setup: The equation x2+x+4+x435=0x^{2}+|x+4|+|x-4|-35=0 relies on absolute value boundaries. We must partition the domain to find all valid real roots, then calculate the sum of their squares. Step 1: Notice the inherent symmetry. Since x+4+x4|x+4| + |x-4| is an even function, if xx is a valid root, x-x is also a root. Step 2: Evaluate Case 1 (x4x \ge 4). Both absolute values evaluate to their positive counterparts: x2+(x+4)+(x4)35=0x^2 + (x + 4) + (x - 4) - 35 = 0 x2+2x35=0x^2 + 2x - 35 = 0 (x+7)(x5)=0(x + 7)(x - 5) = 0 The potential roots are 7-7 and 55. Because our domain is strictly x4x \ge 4, x=5x = 5 is a valid root. Step 3: Evaluate Case 2 (4<x<4-4 < x < 4). The first term remains positive, but the second evaluates to its negative counterpart: x2+(x+4)+(4x)35=0x^2 + (x + 4) + (4 - x) - 35 = 0 x2+835=0x^2 + 8 - 35 = 0 x227=0    x=±27±5.196x^2 - 27 = 0 \implies x = \pm\sqrt{27} \approx \pm 5.196 Because ±5.196\pm 5.196 falls strictly outside the bounded domain of (4,4)(-4, 4), no valid roots exist in this region. Step 4: Evaluate Case 3 (x4x \le -4). Both absolute values flip sign: x2(x+4)(x4)35=0x^2 - (x + 4) - (x - 4) - 35 = 0 x22x35=0x^2 - 2x - 35 = 0 (x7)(x+5)=0(x - 7)(x + 5) = 0 The potential roots are 77 and 5-5. Because our domain is strictly x4x \le -4, x=5x = -5 is a valid root. This agrees with the symmetry noted in Step 1. The two valid real roots are 55 and 5-5. Step 5: Calculate the sum of squares. Sum=(5)2+(5)2=25+25=50\text{Sum} = (5)^2 + (-5)^2 = 25 + 25 = 50 Final Answer: 50
Q22:ipmat indore 2022QATrianglesEasyMCQ · MCQ
The lengths of the sides of a triangle are x,21x, 21 and 4040, where xx is the shortest side. A possible value of xx is:
  • A18
  • B20
  • C19
  • D16
Pick an option to attempt
The Setup: A triangle is composed of side lengths x,21x, 21 and 4040, where xx is stated to be the shortest side. We must determine a viable integer value for xx bounded by the triangle inequality. Step 1: Apply the triangle inequality theorem. For three lengths to successfully form a closed triangle, the sum of the two shorter sides must strictly exceed the longest side. x+21>40    x>19x + 21 > 40 \implies x > 19 Step 2: Apply the specific length constraint. The problem states that xx is the shortest side. Therefore, xx must be less than or equal to 2121. Combining both strict inequalities: 19<x2119 < x \le 21 Step 3: Evaluate the given options. The mathematically possible integer values for xx are 2020 and 2121. Reviewing the multiple-choice options provided (18,20,19,1618, 20, 19, 16), the only valid candidate listed is 2020. Final Answer: 20
Q23:ipmat indore 2022QADivisibility RulesEasyMCQ · MCQ
If the five-digit number abcde is divisible by 6, then which of the following numbers is not necessarily divisible by 6?
  • Aedcba
  • Beee
  • Cbbadcacede
  • Dcdbae
Pick an option to attempt
The Setup: We are given a 55-digit number abcdeabcde that is fully divisible by 66. We need to evaluate four altered configurations to see which is *not necessarily* divisible by 66. Step 1: Establish the divisibility rule for 6. A number is divisible by 66 if and only if it is mathematically divisible by both 22 (its unit digit is even) and 33 (the sum of its digits is a multiple of 33). For abcdeabcde: 1. a+b+c+d+e0(mod3)a+b+c+d+e \equiv 0 \pmod 3 2. ee is an even digit. Step 2: Test the proposed configurations. * **Option 2 (eeeeee):** Sum is 3e3e (divisible by 33). Ends in ee (even). Always divisible by 66. * **Option 3 (bbadcacedebbadcacede):** Sum is 2a+2b+2c+2d+2e=2(sum)2a + 2b + 2c + 2d + 2e = 2(\text{sum}). Since the original sum is divisible by 33, 2×sum2 \times \text{sum} is also divisible by 33. Ends in ee (even). Always divisible by 66. * **Option 4 (cdbaecdbae):** Sum is the same as the original (divisible by 33). Ends in ee (even). Always divisible by 66. * **Option 1 (edcbaedcba):** The sum of the digits remains the same (divisible by 33). However, the unit digit is now aa. We only know ee is even; aa can be either odd or even. Therefore, edcbaedcba is not guaranteed to be even, meaning it is not necessarily divisible by 66. Final Answer: edcba
Q24:ipmat indore 2022QAPermutation & CombinationMediumMCQ · MCQ
In how many ways can the letters of the word MANAGEMENT be arranged such that no two vowels appear together?
  • A75600
  • B25200
  • C37800
  • D21600
Pick an option to attempt
The Setup: We must arrange the 1010 letters of MANAGEMENT so that no two vowels are adjacent. This relies on the Gap Method of combinatorics. Step 1: Audit the frequency of the letters. The word MANAGEMENT consists of 1010 letters: Vowels (44 total): A (22), E (22). Consonants (66 total): M (22), N (22), G (11), T (11). Step 2: Arrange the consonants. First, place the 66 consonants in a row. The number of unique permutations accounting for identical letters is: 6!2!×2!=7204=180 ways\frac{6!}{2! \times 2!} = \frac{720}{4} = 180 \text{ ways} Step 3: Place the vowels in the gaps. Arranging 66 consonants in a line creates exactly 77 gaps (including the outside ends) where vowels can be slotted to ensure they never touch. We must choose 44 gaps for our 44 vowels: (74)=35 ways\binom{7}{4} = 35 \text{ ways} Next, arrange the 44 vowels (A, A, E, E) within those 44 chosen gaps: 4!2!×2!=244=6 ways\frac{4!}{2! \times 2!} = \frac{24}{4} = 6 \text{ ways} Step 4: Calculate the total configurations. Multiply the independent combinatorics together: Total Ways=180×35×6=180×210=37800\text{Total Ways} = 180 \times 35 \times 6 = 180 \times 210 = 37800 Final Answer: 37800
Q25:ipmat indore 2022QAMixture & AlligationEasyMCQ · MCQ
In a room, there are nn persons whose average height is 160 cm160 \ \text{cm}. If mm more persons, whose average height is 172 cm172 \ \text{cm}, enter the room, then the average height of all persons in the room becomes 164 cm164 \ \text{cm}. Then m:nm: n is
  • A1:21 : 2
  • B1:31 : 3
  • C3:13 : 1
  • D2:12 : 1
Pick an option to attempt
The Setup: This is a weighted average problem mapping two groups of distinct heights into a combined new average height. We can isolate the ratio of group sizes using the Alligation method. Step 1: Define the parameters for Alligation. Group 1 (nn persons): Average height = 160 cm160 \text{ cm}. Group 2 (mm persons): Average height = 172 cm172 \text{ cm}. Mixture (Combined group): Average height = 164 cm164 \text{ cm}. Step 2: Apply the Alligation cross-difference formula. The ratio of the quantities (n:mn : m) is inversely proportional to the distances their specific averages sit from the combined mixture mean. n:m=(172164):(164160)n : m = (172 - 164) : (164 - 160) n:m=8:4n : m = 8 : 4 n:m=2:1n : m = 2 : 1 Step 3: Evaluate the requested ratio. We must explicitly provide the ratio m:nm : n. Since n:m=2:1n : m = 2 : 1, the ratio m:nm : n is exactly 1:21 : 2. Final Answer: 1:21 : 2
Q26:ipmat indore 2022QAProgression & SeriesMediumMCQ · MCQ
The sum of the first 15 terms in an arithmetic progression is 200, while the sum of the next 15 terms is 350. Then the common difference is
  • A79\frac{7}{9}
  • B23\frac{2}{3}
  • C49\frac{4}{9}
  • D13\frac{1}{3}
Pick an option to attempt
The Setup: We are given two continuous summation blocks of an Arithmetic Progression (S115S_{1-15} and S1630S_{16-30}). We must build a system of linear equations mapping the progression formula to isolate the common difference dd. Step 1: Translate the sums into standard AP formulation. Let the first term be aa and the common difference be dd. The sum of an AP is Sn=n2(2a+(n1)d)S_n = \frac{n}{2}(2a + (n-1)d). Sum of the first 15 terms (S15S_{15}) = 200200. 200=152(2a+14d)=15(a+7d)    a+7d=20015=403200 = \frac{15}{2}(2a + 14d) = 15(a + 7d) \implies a + 7d = \frac{200}{15} = \frac{40}{3} Step 2: Evaluate the total cumulative sum constraint. The sum of the *next* 15 terms is 350350. This means the total sum of the first 30 terms (S30S_{30}) is 200+350=550200 + 350 = 550. 550=302(2a+29d)=15(2a+29d)    2a+29d=55015=1103550 = \frac{30}{2}(2a + 29d) = 15(2a + 29d) \implies 2a + 29d = \frac{550}{15} = \frac{110}{3} Step 3: Solve the linear system for dd. Multiply the first simplified equation by 22 to align coefficients: 2a+14d=8032a + 14d = \frac{80}{3} Subtract this from the second equation: (2a+29d)(2a+14d)=1103803(2a + 29d) - (2a + 14d) = \frac{110}{3} - \frac{80}{3} 15d=303=1015d = \frac{30}{3} = 10 d=1015=23d = \frac{10}{15} = \frac{2}{3} Final Answer: 23\frac{2}{3}
Q27:ipmat indore 2022QAMatrices & DeterminantsMediumMCQ · MCQ
Suppose a,ba, b and cc are integers such that a>b>c>0a>b>c>0, and A=[abcbcacab]A=\left[\begin{array}{lll}a & b & c \\ b & c & a \\ c & a & b\end{array}\right]. Then the value of the determinant of AA is
  • Acan be positive or negative
  • Bis positive
  • Cis negative
  • Dis zero
Pick an option to attempt
The Setup: A specific circulant 3×33 \times 3 matrix AA is populated with integers a>b>c>0a > b > c > 0. We need to evaluate the algebraic sign of its determinant. Step 1: Expand the determinant of Matrix AA. A=[abcbcacab]A = \begin{bmatrix} a & b & c \\ b & c & a \\ c & a & b \end{bmatrix} Calculate the determinant using the standard top-row expansion: det(A)=a(bca2)b(b2ac)+c(abc2)\det(A) = a(bc - a^2) - b(b^2 - ac) + c(ab - c^2) det(A)=abca3b3+abc+abcc3\det(A) = abc - a^3 - b^3 + abc + abc - c^3 det(A)=3abca3b3c3\det(A) = 3abc - a^3 - b^3 - c^3 Step 2: Factor the resulting polynomial. The expression a3+b3+c33abca^3 + b^3 + c^3 - 3abc possesses a highly standardized factorization identity: a3+b3+c33abc=12(a+b+c)[(ab)2+(bc)2+(ca)2]a^3 + b^3 + c^3 - 3abc = \frac{1}{2}(a+b+c)[(a-b)^2 + (b-c)^2 + (c-a)^2] Notice that our determinant is the exact algebraic negative of this expression: det(A)=(12(a+b+c)[(ab)2+(bc)2+(ca)2])\det(A) = - \left( \frac{1}{2}(a+b+c)[(a-b)^2 + (b-c)^2 + (c-a)^2] \right) Step 3: Evaluate the bounds of the factored terms. We are strictly given a>b>c>0a > b > c > 0. Because all terms are strictly positive, their sum (a+b+c)(a+b+c) is strictly positive. Because the terms are strictly unequal, the squared differences (ab)2,(bc)2,(ca)2(a-b)^2, (b-c)^2, (c-a)^2 are strictly positive non-zeros. Thus, the entire bracketed term evaluates to a strictly positive number. Because a negative sign sits in front of it, the total determinant is strictly negative. Final Answer: is negative
Q28:ipmat indore 2022QATrianglesMediumMCQ · MCQ
In a right-angled triangle ABC, the hypotenuse AC is of length 13 cm. A line drawn connecting the midpoints D and E of sides AB and AC is found to be 6 cm in length. The length of BC is
  • A1212 cm
  • B55 cm
  • C232 \sqrt{3} cm
  • D88 cm
Pick an option to attempt
The Setup: In a right-angled triangle ABCABC, the hypotenuse ACAC is 13 cm13\text{ cm}. The segment DEDE joining the midpoint of the leg ABAB to the midpoint of the hypotenuse ACAC measures 6 cm6\text{ cm}. We must find the length of BCBC. Step 1: Map the geometry using the Midpoint Theorem. The problem defines a line segment drawn connecting the midpoints (DD and EE) of two sides of a triangle (ABAB and ACAC). According to the Triangle Midpoint Theorem, the line segment connecting the midpoints of two sides of a triangle is perfectly parallel to the third side and exactly half of its length. DE=12BCDE = \frac{1}{2} BC Step 2: Calculate the base. We are explicitly given that DE=6 cmDE = 6\text{ cm}. 6=12BC    BC=12 cm6 = \frac{1}{2} BC \implies BC = 12\text{ cm} *(The hypotenuse measurement of 13 is consistent data: with BC=12BC = 12 and AC=13AC = 13, the remaining leg AB=5AB = 5, forming the standard 5-12-13 Pythagorean triple.)* Final Answer: 1212 cm
Q29:ipmat indore 2022QAMatrices & DeterminantsMediumMCQ · MCQ
If A=[10120]A=\left[\begin{array}{ll}1 & 0 \\ \frac{1}{2} & 0\end{array}\right] then A2022A^{2022} is
  • A[101220220]\left[\begin{array}{cc}1 & 0 \\ \frac{1}{2^{2022}} & 0\end{array}\right]
  • B[1010110]\left[\begin{array}{cc}1 & 0 \\ 1011 & 0\end{array}\right]
  • C[1020220]\left[\begin{array}{cc}1 & 0 \\ 2022 & 0\end{array}\right]
  • DNone of these
Pick an option to attempt
The Setup: We are given A=[10120]A = \begin{bmatrix} 1 & 0 \\ \frac{1}{2} & 0 \end{bmatrix} and must identify A2022A^{2022} among the listed options. The decisive detail is the bottom-right entry, which is 00. Step 1: Compute A2A^2. A2=[10120][10120]=[1(1)+0(12)1(0)+0(0)12(1)+0(12)12(0)+0(0)]=[10120]=AA^2 = \begin{bmatrix} 1 & 0 \\ \frac{1}{2} & 0 \end{bmatrix} \begin{bmatrix} 1 & 0 \\ \frac{1}{2} & 0 \end{bmatrix} = \begin{bmatrix} 1(1) + 0\left(\frac{1}{2}\right) & 1(0) + 0(0) \\ \frac{1}{2}(1) + 0\left(\frac{1}{2}\right) & \frac{1}{2}(0) + 0(0) \end{bmatrix} = \begin{bmatrix} 1 & 0 \\ \frac{1}{2} & 0 \end{bmatrix} = A Because the second column of AA is entirely zero, multiplying by AA reproduces AA exactly. Step 2: Extend the result to every power. The matrix is therefore idempotent (A2=AA^2 = A). By induction, every higher power collapses back to AA: A3=A2A=AA=A,A4=A,,An=A for all n1A^3 = A^2 A = A A = A, \qquad A^4 = A, \qquad \dots, \qquad A^n = A \text{ for all } n \ge 1 The bottom-left entry never grows. A2022=A=[10120]A^{2022} = A = \begin{bmatrix} 1 & 0 \\ \frac{1}{2} & 0 \end{bmatrix} Step 3: Compare against the given options. The three explicit choices offer bottom-left entries of 122022\frac{1}{2^{2022}}, 10111011 and 20222022. Our result has bottom-left entry 12\frac{1}{2}, which matches none of them. *A note on the trap:* had the bottom-right entry been 11 rather than 00, the matrix would satisfy An=[10n21]A^n = \begin{bmatrix} 1 & 0 \\ \frac{n}{2} & 1 \end{bmatrix}, giving a bottom-left entry of 20222=1011\frac{2022}{2} = 1011. That is precisely the decoy offered in the second option. With the printed 00 in the bottom-right, that reasoning does not apply and the power never accumulates. Final Answer: None of these
Q30:ipmat indore 2022QAFunctionsMediumMCQ · MCQ
Let A={1,2,3}A=\{1,2,3\} and B={a,b}B=\{a, b\}. Assuming all relations from set AA to set BB are equally likely, what is the probability that a relation from AA to BB is also a function?
  • A18\frac{1}{8}
  • B12\frac{1}{2}
  • C1
  • D3226\frac{3^{2}}{2^{6}}
Pick an option to attempt
The Setup: Set A={1,2,3}A = \{1, 2, 3\} and Set B={a,b}B = \{a, b\}. If we pull randomly from the pool of all possible mathematical relations mapping A to B, we need the probability that the relation is specifically a valid function. Step 1: Calculate the size of the total sample space (all relations). A mathematical relation from AA to BB is defined as any possible subset of the Cartesian product A×BA \times B. The cardinality of the Cartesian product is A×B=3×2=6|A| \times |B| = 3 \times 2 = 6. The total number of unique relations (subsets) is 2A×B=26=642^{|A \times B|} = 2^6 = 64. Step 2: Calculate the size of the restricted target group (all functions). A function is a highly specific relation where every element in set AA maps to exactly one valid element in set BB. Each of the 33 elements in AA has exactly 22 choices to map to in BB. Total number of functions = BA=23=8|B|^{|A|} = 2^3 = 8. Step 3: Calculate the resulting probability. Probability=Target OutcomesTotal Outcomes=864=18\text{Probability} = \frac{\text{Target Outcomes}}{\text{Total Outcomes}} = \frac{8}{64} = \frac{1}{8} Final Answer: 18\frac{1}{8}
Q31:ipmat indore 2022QATime, Speed & DistanceMediumMCQ · MCQ
In a 400-metre race, Ashok beats Bipin and Chandan respectively by 15 seconds and 25 seconds. If Ashok beats Bipin by 150 metres, by how many metres does Bipin beat Chandan in the race?
  • A80
  • B100
  • C150
  • D50
Pick an option to attempt
The Setup: Three runners (Ashok, Bipin, Chandan) race over a 400m400\text{m} distance. Using their offset finishing times and a distance offset, we must evaluate the specific physical distance between Bipin and Chandan when Bipin finishes the race. Step 1: Establish the time relationships. Let Ashok's finishing time for 400m400\text{m} be tAt_A. Ashok beats Bipin by 1515 seconds     tB=tA+15\implies t_B = t_A + 15. Ashok beats Chandan by 2525 seconds     tC=tA+25\implies t_C = t_A + 25. Step 2: Calculate Ashok's finishing time using the distance discrepancy. Ashok beats Bipin by exactly 150m150\text{m}. This means when Ashok finished at time tAt_A, Bipin had only run 400150=250m400 - 150 = 250\text{m}. We know Bipin completes the full 400m400\text{m} at a constant speed in time (tA+15)(t_A + 15). Bipin's Speed = 250tA=400tA+15\frac{250}{t_A} = \frac{400}{t_A + 15} Cross-multiply to solve for tAt_A: 250(tA+15)=400tA250(t_A + 15) = 400 t_A 250tA+3750=400tA    150tA=3750    tA=25 seconds250 t_A + 3750 = 400 t_A \implies 150 t_A = 3750 \implies t_A = 25\text{ seconds} Step 3: Calculate constant speeds for Bipin and Chandan. Bipin's finishing time = 25+15=40 s25 + 15 = 40\text{ s}. Speed VB=40040=10 m/sV_B = \frac{400}{40} = 10\text{ m/s}. Chandan's finishing time = 25+25=50 s25 + 25 = 50\text{ s}. Speed VC=40050=8 m/sV_C = \frac{400}{50} = 8\text{ m/s}. Step 4: Calculate the distance gap at Bipin's finish. Bipin finishes the race precisely at the 4040-second mark. At 4040 seconds, Chandan has traveled: 40 s×8 m/s=320m40\text{ s} \times 8\text{ m/s} = 320\text{m}. The gap distance is 400320=80m400 - 320 = 80\text{m}. Thus, Bipin beats Chandan by 80m80\text{m}. Final Answer: 80
Q32:ipmat indore 2022QAMixture & AlligationMediumMCQ · MCQ
In a bowl containing 60 ml orange juice, 40 ml of water is poured. Thereafter, 100 ml of apple juice is poured to make a fruit punch. Madhu drinks 50 ml of this fruit punch and comments that the proportion of orange juice needs to be higher for better taste. How much orange juice should be poured into the fruit punch that remained, in order to bring up the level of orange juice to 50 percentage?
  • A100 ml
  • B40 ml
  • C80 ml
  • D60 ml
Pick an option to attempt
The Setup: A mixed volume fruit punch starts out with unequal ratios. After some is consumed, pure orange juice is added back to strictly raise its proportion to 50%50\% of the newly defined mixture. Step 1: Establish the baseline volume ratios of the mixture. Initial ingredients: 60ml60\text{ml} orange juice (OJ), 40ml40\text{ml} water (W). Subtotal = 100ml100\text{ml}. Add 100ml100\text{ml} apple juice (AJ). Grand total = 200ml200\text{ml}. The proportional composition of the punch is: OJ=60200=30%\text{OJ} = \frac{60}{200} = 30\% W=40200=20%\text{W} = \frac{40}{200} = 20\% AJ=100200=50%\text{AJ} = \frac{100}{200} = 50\% Step 2: Calculate volumes remaining after consumption. Madhu drinks 50ml50\text{ml} of the punch. Remaining total volume = 200ml50ml=150ml200\text{ml} - 50\text{ml} = 150\text{ml}. Because mixtures are perfectly homogenous, the 30%30\% ratio is maintained in the leftover fluid. Volume of OJ remaining = 30%30\% of 150=45ml150 = 45\text{ml}. Step 3: Calculate the required OJ addition. Let xx be the volume in ml\text{ml} of pure OJ poured back into the punch. The new total volume of OJ is 45+x45 + x. The new total volume of the entire punch is 150+x150 + x. We require the new OJ ratio to be exactly 50%50\%: 45+x150+x=0.5\frac{45 + x}{150 + x} = 0.5 45+x=0.5(150+x)45 + x = 0.5(150 + x) 45+x=75+0.5x45 + x = 75 + 0.5x 0.5x=30    x=60ml0.5x = 30 \implies x = 60\text{ml} Final Answer: 60 ml
Q33:ipmat indore 2022QAConic SectionsMediumMCQ · MCQ
The curve represented by the equation x2sin2sin3+y2cos2cos3=1\dfrac{x^{2}}{\sin \sqrt{2}-\sin \sqrt{3}}+\dfrac{y^{2}}{\cos \sqrt{2}-\cos \sqrt{3}}=1 is
  • Aan ellipse with the foci on the y-axis
  • Ban ellipse with the foci on the x-axis
  • Ca hyperbola with the foci on the x-axis
  • Da hyperbola with the foci on the y-axis
Pick an option to attempt
The Setup: We are asked to classify a conic section represented by an equation with complex trigonometric constants in its denominators. Step 1: Analyze the standard conic equation format. The equation takes the structure x2A+y2B=1\frac{x^2}{A} + \frac{y^2}{B} = 1. The specific conic shape depends rigidly on the algebraic signs of AA and BB. Step 2: Evaluate the sign of denominator AA. A=sin(2)sin(3)A = \sin(\sqrt{2}) - \sin(\sqrt{3}). Note that 21.414\sqrt{2} \approx 1.414 rad and 31.732\sqrt{3} \approx 1.732 rad. π/21.571\pi/2 \approx 1.571 rad. Thus, 2\sqrt{2} resides in the first quadrant and 3\sqrt{3} resides in the second quadrant. The sine function acts symmetrically around its peak at π/2\pi/2. Distance of 2\sqrt{2} from π/2\pi/2 is 1.4141.571=0.157|1.414 - 1.571| = 0.157. Distance of 3\sqrt{3} from π/2\pi/2 is 1.7321.571=0.161|1.732 - 1.571| = 0.161. Because 2\sqrt{2} sits slightly closer to the absolute peak than 3\sqrt{3}, sin(2)>sin(3)\sin(\sqrt{2}) > \sin(\sqrt{3}). Thus, AA is strictly positive. Step 3: Evaluate the sign of denominator BB. B=cos(2)cos(3)B = \cos(\sqrt{2}) - \cos(\sqrt{3}). The cosine function is strictly and continuously decreasing on the interval (0,π)(0, \pi). Because 2<3\sqrt{2} < \sqrt{3}, it follows rigidly that cos(2)>cos(3)\cos(\sqrt{2}) > \cos(\sqrt{3}). Thus, BB is strictly positive. Because both AA and BB are positive, the equation represents an ellipse. Let A=a2A = a^2 and B=b2B = b^2. Step 4: Find the major axis. To locate the foci, we must compare the magnitudes of a2a^2 and b2b^2. a2b2=(sin2sin3)(cos2cos3)=(sin2cos2)(sin3cos3)a^2 - b^2 = (\sin\sqrt{2} - \sin\sqrt{3}) - (\cos\sqrt{2} - \cos\sqrt{3}) = (\sin\sqrt{2} - \cos\sqrt{2}) - (\sin\sqrt{3} - \cos\sqrt{3}) Let f(x)=sinxcosxf(x) = \sin x - \cos x. Its derivative is f(x)=cosx+sinxf'(x) = \cos x + \sin x. On the interval containing 2\sqrt{2} and 3\sqrt{3}, sinx\sin x stays near 11 while cosx\cos x is small in magnitude, so f(x)>0f'(x) > 0 and f(x)f(x) is increasing there. Because f(x)f(x) is increasing, f(2)<f(3)f(\sqrt{2}) < f(\sqrt{3}). Thus, a2b2<0    a2<b2a^2 - b^2 < 0 \implies a^2 < b^2. Because the yy-denominator is larger, the major axis is vertical, placing the foci strictly on the yy-axis. Final Answer: an ellipse with the foci on the y-axis
Q34:ipmat indore 2022QAFunctionsEasyMCQ · MCQ
A set of all possible values the function f(x)=xxf(x)=\dfrac{x}{|x|}, where x0x \neq 0, takes is
  • A{1}\{1\}
  • B{1,1}\{1,-1\}
  • C{1,0}\{1,0\}
  • D{1,0,1}\{1,0,-1\}
Pick an option to attempt
The Setup: We need to specify the range (the set of all possible outputs) for the absolute value ratio function f(x)=xxf(x)=\frac{x}{|x|}. Step 1: Analyze the piecewise domains of the function. The function possesses a domain restricting x0x \neq 0. If x>0x > 0 (positive numbers), then x=x|x| = x. f(x)=xx=1f(x) = \frac{x}{x} = 1 If x<0x < 0 (negative numbers), then x=x|x| = -x. f(x)=xx=1f(x) = \frac{x}{-x} = -1 Step 2: Formulate the set of possible values. Since the function mathematically collapses into exactly two static outputs dependent on algebraic sign, its absolute range is limited exclusively to those two integers. The set of outputs is {1,1}\{1, -1\}. Final Answer: {1,1}\{1,-1\}
Q35:ipmat indore 2022QAHCF & LCMEasyMCQ · MCQ
When the square of the difference of two natural numbers is subtracted from the square of the sum of the same two numbers and the result is divided by four, we get
  • Athe product of the LCM and HCF of the two numbers
  • Bthe HCF of the two numbers
  • Cthe LCM of the two numbers
  • Dthe square of the product of the two numbers
Pick an option to attempt
The Setup: Two natural numbers are subjected to a specific string of algebraic operations. We must simplify the operations to find the resulting identity. Step 1: Map the text to algebraic formulation. Let the two natural numbers be aa and bb. 'Square of the difference' = (ab)2(a-b)^2. 'Square of the sum' = (a+b)2(a+b)^2. The text requires: (a+b)2(ab)24\frac{(a+b)^2 - (a-b)^2}{4}. Step 2: Expand and simplify the expression. Expand the squares: (a2+2ab+b2)(a22ab+b2)4\frac{(a^2 + 2ab + b^2) - (a^2 - 2ab + b^2)}{4} Distribute the negative sign: a2+2ab+b2a2+2abb24\frac{a^2 + 2ab + b^2 - a^2 + 2ab - b^2}{4} The squares cancel out perfectly: 4ab4=ab\frac{4ab}{4} = ab The result is simply the direct mathematical product of the two original natural numbers. Step 3: Relate to the Number System rules. A fundamental property of arithmetic states that the product of any two natural numbers equals the product of their Least Common Multiple (LCM) and their Highest Common Factor (HCF). a×b=LCM(a,b)×HCF(a,b)a \times b = \text{LCM}(a,b) \times \text{HCF}(a,b) Final Answer: the product of the LCM and HCF of the two numbers
Q36:ipmat indore 2022QARatio, Proportion & VariationEasyMCQ · MCQ
The cost of a piece of jewellery is proportional to the square of its weight. A piece of jewellery weighing 10 grams is INR 3600. The cost of a piece of jewellery of the same kind weighing 4 grams is
  • AINR 1220
  • BINR 600
  • CINR 576
  • DINR 1440
Pick an option to attempt
The Setup: A piece of jewellery's cost is strictly proportional to the square of its weight. Using a known data point, we must calculate the cost for a lighter piece. Step 1: Establish the mathematical proportionality rule. Let CC be the cost and WW be the weight. CW2    C=kW2C \propto W^2 \implies C = k \cdot W^2 where kk is the constant of proportionality. Step 2: Isolate the constant kk. We are given a data point: a 1010-gram piece costs INR 36003600. 3600=k×(10)23600 = k \times (10)^2 3600=100k    k=363600 = 100k \implies k = 36 Step 3: Evaluate the secondary cost. Calculate the cost for a piece weighing 44 grams: C=36×(4)2C = 36 \times (4)^2 C=36×16=576C = 36 \times 16 = 576 Final Answer: INR 576
Q37:ipmat indore 2022QASet TheoryEasyMCQ · MCQ
Let AA and BB be two sets such that the Cartesian product A×BA \times B consists of four elements. If two elements of A×BA \times B are (1,4)(1,4) and (4,1)(4,1), then
  • ANone of these
  • BA×BB×AA \times B \neq B \times A
  • CA×B\emptyset \in A \times B
  • DA×B=B×AA \times B=B \times A
Pick an option to attempt
The Setup: For sets AA and BB, the Cartesian product A×BA \times B yields exactly four elements, two of which are specifically (1,4)(1, 4) and (4,1)(4, 1). We evaluate the mathematical relationship between the parent sets. Step 1: Define the cardinality constraints. The total size of the Cartesian product is A×B=A×B=4|A \times B| = |A| \times |B| = 4. By definition, for a Cartesian product (x,y)A×B(x,y) \in A \times B, the first element belongs to AA and the second belongs to BB. The presence of (1,4)(1, 4) dictates that 1A1 \in A and 4B4 \in B. The presence of (4,1)(4, 1) dictates that 4A4 \in A and 1B1 \in B. Step 2: Formulate the parent sets. We have confirmed that set AA inherently contains at least two distinct elements: {1,4}\{1, 4\}. Thus A2|A| \ge 2. We have confirmed that set BB inherently contains at least two distinct elements: {1,4}\{1, 4\}. Thus B2|B| \ge 2. Because A×B|A| \times |B| must rigidly equal 44, the only mathematically viable integer size for both subsets is precisely 22. Therefore, there are no hidden elements. A={1,4}A = \{1, 4\} and B={1,4}B = \{1, 4\}. Step 3: Evaluate the target relation. Because AA exactly equals BB, their Cartesian products yield completely identical mappings. A×B=B×AA \times B = B \times A Final Answer: A×B=B×AA \times B=B \times A
Q38:ipmat indore 2022QAFunctionsHardMCQ · MCQ
If f(x2+f(y))=xf(x)+yf\left(x^{2}+f(y)\right)=x f(x)+y for all non-negative integers xx and yy, then the value of [f(0)]2+f(0)[f(0)]^{2}+f(0) equals _________.
  • A2
  • B0
  • C6
  • D1
Pick an option to attempt
The Setup: A functional mapping rule dictates f(x2+f(y))=xf(x)+yf(x^2 + f(y)) = x f(x) + y for all non-negative integers x,yx, y. We must solve for f(0)f(0) to evaluate [f(0)]2+f(0)[f(0)]^2 + f(0). Step 1: Exploit substitution to define the function. Let x=0x = 0. The equation becomes: f(02+f(y))=0f(0)+y    f(f(y))=yf(0^2 + f(y)) = 0 \cdot f(0) + y \implies f(f(y)) = y This proves that the function is an involution (it acts identically as its own inverse). Consequently, substituting y=0y = 0 yields f(f(0))=0f(f(0)) = 0. Step 2: Set up a root evaluation using the involution property. Let c=f(0)c = f(0). Substituting this into our involution proof implies f(c)=0f(c) = 0. Now, set y=0y = 0 in the original primary equation: f(x2+f(0))=xf(x)f(x^2 + f(0)) = x f(x) Substitute x=cx = c: f(c2+c)=cf(c)f(c^2 + c) = c \cdot f(c) Because we proved f(c)=0f(c) = 0: f(c2+c)=c(0)=0f(c^2 + c) = c(0) = 0 Step 3: Solve for cc. Because the function maps c2+cc^2 + c to 00, and we previously established that f(c)f(c) uniquely maps to 00 (since ff acts as a strict bijection due to f(f(x))=xf(f(x))=x), the internal arguments must be rigidly equal: c2+c=c    c2=0    c=0c^2 + c = c \implies c^2 = 0 \implies c = 0 Thus, f(0)=0f(0) = 0. Step 4: Evaluate the requested expression. We must calculate [f(0)]2+f(0)[f(0)]^2 + f(0). 02+0=00^2 + 0 = 0 Final Answer: 0
Q39:ipmat indore 2022QAFactorisationMediumMCQ · MCQ
If one of the factors of the number 37281733^{7} 2^{8} 17^{3} is randomly chosen, then the probability that the chosen factor will be a perfect square is
  • A536\frac{5}{36}
  • B112\frac{1}{12}
  • C340\frac{3}{40}
  • D532\frac{5}{32}
Pick an option to attempt
The Setup: A factor is pulled randomly from the large integer N=3728173N = 3^7 \cdot 2^8 \cdot 17^3. We must identify the probability that this chosen factor acts as a perfect square. Step 1: Calculate the size of the sample space (total factors). Using the prime factorization exponent rule, the total number of divisors of paqbrcp^a q^b r^c is (a+1)(b+1)(c+1)(a+1)(b+1)(c+1). Total Factors=(7+1)(8+1)(3+1)=8×9×4=288\text{Total Factors} = (7+1)(8+1)(3+1) = 8 \times 9 \times 4 = 288 Step 2: Define the constraints for perfect square factors. For a factor to exist as a perfect square, the exponents of all of its individual prime bases must be even integers. Factor format: 32x22y172z3^{2x} \cdot 2^{2y} \cdot 17^{2z}. We evaluate the valid even exponent boundaries: * Base 3: 02x7    2x{0,2,4,6}0 \le 2x \le 7 \implies 2x \in \{0, 2, 4, 6\} (4 valid choices). * Base 2: 02y8    2y{0,2,4,6,8}0 \le 2y \le 8 \implies 2y \in \{0, 2, 4, 6, 8\} (5 valid choices). * Base 17: 02z3    2z{0,2}0 \le 2z \le 3 \implies 2z \in \{0, 2\} (2 valid choices). Step 3: Calculate the target pool and the probability. Multiply the independent choices together to find the number of valid square factors: Perfect Square Factors=4×5×2=40\text{Perfect Square Factors} = 4 \times 5 \times 2 = 40 The resulting probability is: Probability=40288=536\text{Probability} = \frac{40}{288} = \frac{5}{36} Final Answer: 536\frac{5}{36}
Q40:ipmat indore 2022QADivisibility RulesMediumMCQ · MCQ
The number of four-digit integers which are greater than 1000 and divisible by both 2 and 3, but not by 5, is
  • A1333
  • B1666
  • C1200
  • D1500
Pick an option to attempt
The Setup: We are asked to count the quantity of four-digit integers logically bounded by specific divisibility rules (divisible by 22 and 33, but strictly not by 55). Step 1: Establish the numerical boundaries. The domain represents four-digit integers greater than 10001000. The inclusive range is mathematically defined as 1001N99991001 \le N \le 9999. Step 2: Apply the primary inclusion divisibility rule. A number mathematically divisible by both 22 and 33 is inherently divisible by their LCM, which is 66. We calculate the count of numbers divisible by 66 within the domain. * Smallest multiple of 66: 10021002 (6×1676 \times 167). * Largest multiple of 66: 99969996 (6×16666 \times 1666). Count =LargestSmallest6+1=999610026+1=1499+1=1500= \frac{\text{Largest} - \text{Smallest}}{6} + 1 = \frac{9996 - 1002}{6} + 1 = 1499 + 1 = 1500. Step 3: Apply the exclusion divisibility rule. We must exclude numbers within this pool that are also divisible by 55. A number divisible by both 66 and 55 is divisible by their LCM, which is 3030. We calculate the count of numbers divisible by 3030 within the domain to subtract them from our pool. * Smallest multiple of 3030: 10201020 (30×3430 \times 34). * Largest multiple of 3030: 99909990 (30×33330 \times 333). Count =9990102030+1=897030+1=299+1=300= \frac{9990 - 1020}{30} + 1 = \frac{8970}{30} + 1 = 299 + 1 = 300. Step 4: Calculate the final target count. Subtract the excluded intersecting pool from the primary included pool: Final Count=1500300=1200\text{Final Count} = 1500 - 300 = 1200 Final Answer: 1200

Other IPMAT Indore papers & sections