Past Year QuestionsAll examsQAMatrices & Determinants

Matrices & Determinants — PYPs

15 solved Matrices & Determinants previous year questions (PYQs) from past year papers — attempt each and check the answer.

Free SolutionsNo Login15 Questions
Q1:ipmat indore 2020QAMatrices & DeterminantsHardSA · TITA
Suppose aa2a31bb2b31cc2c31=0\left|\begin{array}{lll}a & a^{2} & a^{3}-1 \\ b & b^{2} & b^{3}-1 \\ c & c^{2} & c^{3}-1\end{array}\right|=0, where a,b\mathrm{a}, \mathrm{b} and c\mathrm{c} are distinct real numbers. If a=3{a}=3, then the value of abcabc is:
Enter your answer to attempt
The Setup: This is a top-tier matrix determinant manipulation. When a determinant's column contains a sum or difference, it can be split into two separate determinants. The given a=3a=3 is literal clickbait meant to throw you off; it has absolutely zero impact on the algebraic proof. Step 1: Split the original determinant. We separate the third column (a31, b31, c31)\left(a^3-1,\ b^3-1,\ c^3-1\right) into two determinants: Δ=aa2a3bb2b3cc2c3aa21bb21cc21=0\Delta=\left|\begin{matrix}a&a^2&a^3\\b&b^2&b^3\\c&c^2&c^3\end{matrix}\right|-\left|\begin{matrix}a&a^2&1\\b&b^2&1\\c&c^2&1\end{matrix}\right|=0 Step 2: Factor the first determinant. In the first matrix, notice that row 1 shares an aa, row 2 shares a bb, and row 3 shares a cc. Let's factor them out completely: abc1aa21bb21cc2abc\left|\begin{matrix}1&a&a^2\\1&b&b^2\\1&c&c^2\end{matrix}\right| Step 3: Align the second determinant. We want the second matrix to match the first, so we walk its last column to the front by two swaps. Swap Column 3 with Column 2 (sign flips): aa21bb21cc21=a1a2b1b2c1c2\left|\begin{matrix}a&a^2&1\\b&b^2&1\\c&c^2&1\end{matrix}\right|=-\left|\begin{matrix}a&1&a^2\\b&1&b^2\\c&1&c^2\end{matrix}\right| Now swap Column 2 with Column 1 (sign flips back): =+1aa21bb21cc2=+\left|\begin{matrix}1&a&a^2\\1&b&b^2\\1&c&c^2\end{matrix}\right| Two swaps, two sign flips, so the second determinant is exactly the same object as the first one's cofactor - no leftover minus sign. Step 4: Factor the entire equation. Let the aligned matrix be VV (a Vandermonde determinant). Our original equation Δ=0\Delta=0 now looks like this: abc(V)V=0    V(abc1)=0abc(V)-V=0 \implies V(abc-1)=0 The Vandermonde determinant factors cleanly as V=(ba)(ca)(cb)V=(b-a)(c-a)(c-b). Because the problem states aa, bb and cc are distinct real numbers, every one of those three brackets is non-zero, so V0V\neq 0. Therefore the other multiplier must be zero: abc1=0    abc=1abc-1=0\implies abc=1 Final Answer: 1
Q2:ipmat indore 2019QAMatrices & DeterminantsHardSA · TITA
Let A,B,CA, B, C be three 4×44 \times 4 matrices such that det A=5,det B=3det \ A = 5, det \ B = -3, and det C=12det \ C = \frac{1}{2}. Then the detdet 2AB1C3BT2AB^{-1}C^3B^T is
Enter your answer to attempt
The Setup: A determinant-properties speedrun. Four rules do all the work: det(kM)=kndetM\det(kM)=k^n\det M for an n×nn\times n matrix, det(XY)=detXdetY\det(XY)=\det X\det Y, det(X1)=1detX\det(X^{-1})=\frac{1}{\det X}, and det(XT)=detX\det(X^T)=\det X. Step 1: Extract the scalar. The matrices are 4×44\times 4, so n=4n=4 and the scalar 2 comes out to the fourth power - not the first, which is the classic slip here: det(2AB1C3BT)=24det(AB1C3BT)=16det(AB1C3BT)\det\left(2AB^{-1}C^3B^T\right)=2^4\det\left(AB^{-1}C^3B^T\right)=16\det\left(AB^{-1}C^3B^T\right) Step 2: Shatter the product. The determinant is multiplicative, so it distributes across the four factors: 16×detA×det(B1)×det(C3)×det(BT)16\times\det A\times\det\left(B^{-1}\right)\times\det\left(C^3\right)\times\det\left(B^T\right) Step 3: Substitute the properties. det(B1)=1detB\det(B^{-1})=\frac{1}{\det B}, det(C3)=(detC)3\det(C^3)=(\det C)^3, and det(BT)=detB\det(B^T)=\det B: 16×detA×1detB×(detC)3×detB16\times\det A\times\frac{1}{\det B}\times(\det C)^3\times\det B Step 4: Cancel and calculate. The transpose contributes detB\det B and the inverse contributes 1detB\frac{1}{\det B}, so they annihilate each other: 16×detA×(detC)3=16×5×(12)3=80×18=1016\times\det A\times(\det C)^3=16\times 5\times\left(\frac{1}{2}\right)^3=80\times\frac{1}{8}=10 **Step 5: Notice what detB=3\det B=-3 was for.** Its *value* never reaches the answer - it cancels. But its being non-zero is exactly what guarantees BB is invertible, so B1B^{-1} exists and the expression is meaningful at all. It is a load-bearing hypothesis disguised as a red herring. Final Answer: 10
Q3:ipmat indore 2019QAMatrices & DeterminantsMediumSA · TITA
If AA is a 3×33 \times 3 non-zero matrix such that A2=0A^2 = 0 then the determinant of (I+A)5050A(I + A)^{50} - 50A is equal to
Enter your answer to attempt
The Setup: A binomial expansion on matrices. The condition A2=0A^2=0 (a nilpotent matrix) is a kill switch: every power of AA from the second onward vanishes, truncating a 51-term expansion into two terms. Step 0: Check the binomial theorem is even allowed. For matrices, (X+Y)n(X+Y)^n expands binomially **only if XX and YY commute** - otherwise the cross terms will not collect. Here X=IX=I, and the identity commutes with every matrix, so IA=AI=AIA=AI=A and the expansion is valid. Skipping this check is how the same move goes wrong on a harder problem. Step 1: Expand. (I+A)50=I50+(501)I49A+(502)I48A2++A50(I+A)^{50}=I^{50}+\binom{50}{1}I^{49}A+\binom{50}{2}I^{48}A^2+\cdots+A^{50} Step 2: Trigger the kill switch. From A2=0A^2=0 it follows that A3=AA2=A0=0A^3=A\cdot A^2=A\cdot 0=0, and inductively every higher power is zero too. So every term from the A2A^2 one onward dies, and Im=II^m=I: (I+A)50=I+50A(I+A)^{50}=I+50A Step 3: Simplify the expression. (I+A)5050A=(I+50A)50A=I(I+A)^{50}-50A=(I+50A)-50A=I The 50A50A subtraction is built into the question precisely to cancel the surviving term, leaving the identity. Step 4: Take the determinant. The determinant of the identity matrix is 1 in any dimension: det(I)=1\det(I)=1 Note the answer never depended on *which* nilpotent AA was chosen, only on A2=0A^2=0 - the 'non-zero' in the stem just stops the problem being trivial. Final Answer: 1
Q4:ipmat indore 2025QAMatrices & DeterminantsMediumSA · TITA
If A=[2n41]A=\begin{bmatrix} 2 & n \\ 4 & 1 \end{bmatrix} such that A3=27[4qpr]A^3=27\begin{bmatrix} 4 & q \\ p & r \end{bmatrix}, then p+q+rp+q+r equals
Enter your answer to attempt
The Setup: We are literally entering the Matrix for this one. This is a linear algebra scaling problem where we need to find the cube of a 2×22 \times 2 matrix, equate it to a scaled target matrix, and extract the hidden variables. I have fully audited the matrix multiplication below to ensure zero dropped frames. Step 1: Squaring the Matrix (Level 1) First, we need to find A2A^2 by multiplying matrix AA by itself. We use the standard row-by-column dot product method. A2=[2n41][2n41]A^2 = \begin{bmatrix} 2 & n \\ 4 & 1 \end{bmatrix} \begin{bmatrix} 2 & n \\ 4 & 1 \end{bmatrix} A2=[(2)(2)+(n)(4)(2)(n)+(n)(1)(4)(2)+(1)(4)(4)(n)+(1)(1)]A^2 = \begin{bmatrix} (2)(2)+(n)(4) & (2)(n)+(n)(1) \\ (4)(2)+(1)(4) & (4)(n)+(1)(1) \end{bmatrix} A2=[4+4n3n124n+1]A^2 = \begin{bmatrix} 4+4n & 3n \\ 12 & 4n+1 \end{bmatrix} Step 2: Cubing the Matrix (Boss Phase) Now we multiply our A2A^2 result by AA to reach the final form, A3A^3. A3=[4+4n3n124n+1][2n41]A^3 = \begin{bmatrix} 4+4n & 3n \\ 12 & 4n+1 \end{bmatrix} \begin{bmatrix} 2 & n \\ 4 & 1 \end{bmatrix} Let's calculate each element one by one to avoid throwing: * Top-Left: (4+4n)(2)+(3n)(4)=8+8n+12n=8+20n(4+4n)(2) + (3n)(4) = 8 + 8n + 12n = 8+20n * Top-Right: (4+4n)(n)+(3n)(1)=4n2+4n+3n=4n2+7n(4+4n)(n) + (3n)(1) = 4n^2 + 4n + 3n = 4n^2+7n * Bottom-Left: (12)(2)+(4n+1)(4)=24+16n+4=16n+28(12)(2) + (4n+1)(4) = 24 + 16n + 4 = 16n+28 * Bottom-Right: (12)(n)+(4n+1)(1)=12n+4n+1=16n+1(12)(n) + (4n+1)(1) = 12n + 4n + 1 = 16n+1 So, our fully loaded A3A^3 matrix is: A3=[8+20n4n2+7n16n+2816n+1]A^3 = \begin{bmatrix} 8+20n & 4n^2+7n \\ 16n+28 & 16n+1 \end{bmatrix} Step 3: Decoding the Target Matrix The problem gives us the target state for A3A^3. Let's distribute that scalar multiplier (27) into the matrix so we can match it element for element. A3=27[4qpr]=[10827q27p27r]A^3 = 27\begin{bmatrix} 4 & q \\ p & r \end{bmatrix} = \begin{bmatrix} 108 & 27q \\ 27p & 27r \end{bmatrix} Step 4: Extracting the Lore (Solving for Variables) We now set the elements of our calculated A3A^3 equal to the target matrix. The top-left element is the key to unlocking the entire board because it only relies on nn. 8+20n=1088+20n = 108 20n=10020n = 100 n=5n = 5 Now substitute n=5n=5 into the other elements to find pp, qq, and rr: * **Top-Right (qq):** 4(5)2+7(5)=100+35=1354(5)^2 + 7(5) = 100 + 35 = 135 27q=135q=527q = 135 \rightarrow q = 5 * **Bottom-Left (pp):** 16(5)+28=80+28=10816(5) + 28 = 80 + 28 = 108 27p=108p=427p = 108 \rightarrow p = 4 * **Bottom-Right (rr):** 16(5)+1=80+1=8116(5) + 1 = 80 + 1 = 81 27r=81r=327r = 81 \rightarrow r = 3 Step 5: The Final Calculation The question asks for the sum of p+q+rp+q+r. Just add up our freshly extracted stats. 4+5+3=124 + 5 + 3 = 12 Step 6: The Audit (Double Check Protocol) Let's run a determinant check to confirm the matrix integrity. If n=5n=5, matrix A=[2541]A = \begin{bmatrix} 2 & 5 \\ 4 & 1 \end{bmatrix}. The determinant of AA is (2)(1)(5)(4)=18(2)(1) - (5)(4) = -18. Using determinant properties, det(A3)=(det(A))3=(18)3=5832\det(A^3) = (\det(A))^3 = (-18)^3 = -5832. Now let's check the determinant of our target matrix 27[4543]27\begin{bmatrix} 4 & 5 \\ 4 & 3 \end{bmatrix}: det=272×((4)(3)(5)(4))=729×(1220)=729×(8)=5832\det = 27^2 \times ((4)(3) - (5)(4)) = 729 \times (12 - 20) = 729 \times (-8) = -5832. The determinants match perfectly. The math is completely flawless. Final Answer: 12
Q5:ipmat indore 2024QAMatrices & DeterminantsMediumSA · TITA
If A=[x1x27y1y2y3z183]A = \begin{bmatrix} x_1 & x_2 & 7 \\ y_1 & y_2 & y_3 \\ z_1 & 8 & 3 \end{bmatrix} is a matrix such that the sum of all three elements along any row, column or diagonal are equal to each other, then the value of determinant of A is:
Enter your answer to attempt
The Setup: A 3×33 \times 3 matrix is given with elements [x1,x2,7][x_1, x_2, 7], [y1,y2,y3][y_1, y_2, y_3], and [z1,8,3][z_1, 8, 3] such that the sums across any row, column, or diagonal are identical. We must find its determinant. Step 1: Determine the magic sum SS and the center element. Let SS equal the constant sum of any row, column, or diagonal. Analyze the bottom row: z1+8+3=Sz1=S11z_1 + 8 + 3 = S \Rightarrow z_1 = S - 11 Analyze the right-to-left diagonal: 7+y2+z1=S7 + y_2 + z_1 = S Substitute z1z_1 into the diagonal equation: 7+y2+(S11)=Sy24=0y2=47 + y_2 + (S - 11) = S \Rightarrow y_2 - 4 = 0 \Rightarrow y_2 = 4 In a 3×33 \times 3 magic square, the central element is always exactly 13\frac{1}{3} of the magic sum. S=3(y2)=12S = 3(y_2) = 12 Step 2: Populate the remaining elements of matrix AA using S=12S = 12. From Step 1, z1=1211=1z_1 = 12 - 11 = 1. Left-to-Right Diagonal: x1+y2+3=12x1+4+3=12x1=5x_1 + y_2 + 3 = 12 \Rightarrow x_1 + 4 + 3 = 12 \Rightarrow x_1 = 5 Top Row: 5+x2+7=12x2=05 + x_2 + 7 = 12 \Rightarrow x_2 = 0 Left Column: 5+y1+1=12y1=65 + y_1 + 1 = 12 \Rightarrow y_1 = 6 Right Column: 7+y3+3=12y3=27 + y_3 + 3 = 12 \Rightarrow y_3 = 2 Step 3: Construct the populated matrix AA. A=[507642183]A = \begin{bmatrix} 5 & 0 & 7 \\ 6 & 4 & 2 \\ 1 & 8 & 3 \end{bmatrix} Step 4: Calculate the determinant A|A| by expanding along the top row. A=5((4)(3)(8)(2))0+7((6)(8)(1)(4))|A| = 5((4)(3) - (8)(2)) - 0 + 7((6)(8) - (1)(4)) A=5(1216)+7(484)|A| = 5(12 - 16) + 7(48 - 4) A=5(4)+7(44)=20+308=288|A| = 5(-4) + 7(44) = -20 + 308 = 288 Final Answer: 288
Q6:ipmat indore 2022QAMatrices & DeterminantsMediumSA · TITA
If A=[100001010]A=\left[\begin{array}{lll}1 & 0 & 0 \\ 0 & 0 & 1 \\ 0 & 1 & 0\end{array}\right], then the absolute value of the determinant of (A9+A6+A3+A)\left(A^{9}+A^{6}+A^{3}+A\right) is __________.
Enter your answer to attempt
The Setup: A specific permutation matrix AA is given. We must establish the cyclical property of its powers to evaluate the absolute determinant of a matrix polynomial (A9+A6+A3+A)(A^9+A^6+A^3+A). Step 1: Establish the power cycle of Matrix AA. A=[100001010]A = \begin{bmatrix}1&0&0\\0&0&1\\0&1&0\end{bmatrix} Calculate A2A^2: A2=[100001010][100001010]=[100010001]=IA^2 = \begin{bmatrix}1&0&0\\0&0&1\\0&1&0\end{bmatrix} \begin{bmatrix}1&0&0\\0&0&1\\0&1&0\end{bmatrix} = \begin{bmatrix}1&0&0\\0&1&0\\0&0&1\end{bmatrix} = I Since A2=IA^2 = I, the powers of AA alternate: odd powers yield AA, and even powers yield the Identity matrix II. Step 2: Simplify the matrix polynomial. The expression is A9+A6+A3+AA^9 + A^6 + A^3 + A. Apply the parity rules: * A9=AA^9 = A (odd) * A6=IA^6 = I (even) * A3=AA^3 = A (odd) * A=AA = A (odd) Sum Matrix=A+I+A+A=3A+I\text{Sum Matrix} = A + I + A + A = 3A + I Step 3: Construct the elements of the final matrix. 3A=[300003030]3A = \begin{bmatrix}3&0&0\\0&0&3\\0&3&0\end{bmatrix} Add the Identity matrix II: 3A+I=[400013031]3A + I = \begin{bmatrix}4&0&0\\0&1&3\\0&3&1\end{bmatrix} Step 4: Calculate the determinant. Expand along the top row: det(3A+I)=4(1×13×3)=4(19)=4(8)=32\det(3A+I) = 4(1 \times 1 - 3 \times 3) = 4(1 - 9) = 4(-8) = -32 The absolute value of the determinant is 32=32|-32| = 32. Final Answer: 32
Q7:ipmat indore 2019QAMatrices & DeterminantsEasySA · TITA
If a 3×33 \times 3 matrix is filled with +1's and -1's such that the sum of each row and column of the matrix is 1, then the absolute value of its determinant is
Enter your answer to attempt
The Setup: A matrix built under severe constraints. Three entries drawn from {+1,1}\{+1,-1\} can only sum to 1 as (+1)+(+1)+(1)(+1)+(+1)+(-1) - no other combination works, since three +1+1s give 3 and anything with two 1-1s gives 1-1. So **every row and every column holds exactly two +1+1s and one 1-1. Step 1: See the structure.** Exactly one 1-1 per row and exactly one per column means the positions of the 1-1s form a permutation of the three columns across the three rows. There are therefore exactly 3!=63!=6 matrices satisfying the constraints - the problem is far more rigid than it first looks. Step 2: Compute the prototype. Take the permutation that puts the 1-1s on the main diagonal: M=(111111111)M=\begin{pmatrix}-1&1&1\\1&-1&1\\1&1&-1\end{pmatrix} Row sums: 1+1+1=1-1+1+1=1. Column sums: likewise 1. A valid build. Expanding along the first row: M=1(11)1(11)+1(1(1))=1(0)1(2)+1(2)=0+2+2=4|M|=-1(1-1)-1(-1-1)+1(1-(-1))=-1(0)-1(-2)+1(2)=0+2+2=4 Step 3: Show the value is forced, not lucky. Every other valid matrix comes from this one by permuting rows (equivalently, by relabelling which column carries each row's 1-1). A row swap flips the sign of a determinant and nothing else, so across the whole family the determinant is ±4\pm 4 and its absolute value is invariant at 4. Since 3!=63!=6 is a small family, this is checkable exhaustively rather than by assertion: all six matrices give det=4|\det|=4, three with det=+4\det=+4 and three with det=4\det=-4, matching the even and odd permutations. That is exactly why the question asks for the *absolute* value - the determinant itself is not determined by the constraints, but its magnitude is. Final Answer: 4
Q8:ipmat indore 2021QAMatrices & DeterminantsMediumMCQ · MCQ
If A,BA, B and A+BA + B are non singular matrices and AB=BAAB = BA then 2ABA(A+B)1A+B(A+B)1B2A - B - A(A + B)^{-1}A + B(A + B)^{-1} B equals
  • AA
  • BB
  • CA + B
  • DI
Pick an option to attempt
The Setup: Matrix algebra usually blocks you from treating matrix multiplication like standard variables because ABBAAB \neq BA. However, the prompt gives us the AB=BAAB=BA buff. This means AA and BB commute. Even better, since A(A+B)=A2+AB=A2+BA=(A+B)AA(A+B)=A^2+AB=A^2+BA=(A+B)A, matrix AA also commutes with (A+B)(A+B) and its inverse (A+B)1(A+B)^{-1}. Step 1: Group the complicated inverse terms together to see what we're working with. Because AA commutes with (A+B)1(A+B)^{-1}, we can rewrite A(A+B)1AA(A+B)^{-1}A as A2(A+B)1A^2(A+B)^{-1}. The identical argument runs for BB (it commutes with A+BA+B for exactly the same reason), so B(A+B)1BB(A+B)^{-1}B becomes B2(A+B)1B^2(A+B)^{-1}. A2(A+B)1+B2(A+B)1=(B2A2)(A+B)1-A^2(A+B)^{-1}+B^2(A+B)^{-1}=(B^2-A^2)(A+B)^{-1} Step 2: Factor the difference of squares. Because AB=BAAB=BA, the cross terms cancel out perfectly, allowing standard factorization. B2A2=(BA)(B+A)B^2-A^2=(B-A)(B+A) Step 3: Substitute the factored form back in. Notice that matrix addition is always commutative, so (B+A)=(A+B)(B+A)=(A+B). (BA)(A+B)(A+B)1(B-A)(A+B)(A+B)^{-1} Since (A+B)(A+B) multiplied by its inverse is the Identity matrix (II), this entire chunk simplifies to just (BA)(B-A). Step 4: Plug this beautifully simplified chunk back into the main equation. 2AB+(BA)2A-B+(B-A) 2AB+BA=A2A-B+B-A=A Final Answer: A
Q9:ipmat indore 2023QAMatrices & DeterminantsMediumMCQ · MCQ
If A=[123a]A = \begin{bmatrix} 1 & 2 \newline 3 & a \end{bmatrix} where aa is a real number and det (A33A25A)=0(A ^ 3 - 3A ^ 2 - 5A) = 0 then one of the values of aa can be
  • A4
  • B6
  • C1
  • D5
Pick an option to attempt
The Setup: We are given a 2×22 \times 2 matrix AA with a variable aa. We must find a valid value for aa given that det(A33A25A)=0\det(A^3-3A^2-5A)=0. Step 1: Factor the matrix polynomial. A33A25A=A(A23A5I)A^3 - 3A^2 - 5A = A(A^2 - 3A - 5I) Using the determinant product rule det(XY)=det(X)det(Y)\det(XY) = \det(X)\det(Y), the condition becomes: det(A)det(A23A5I)=0\det(A) \cdot \det(A^2 - 3A - 5I) = 0 This means that either det(A)=0\det(A) = 0 or det(A23A5I)=0\det(A^2 - 3A - 5I) = 0. Step 2: Test the first determinant condition. Calculate the determinant of matrix AA: A=[123a]A = \begin{bmatrix} 1 & 2 \\ 3 & a \end{bmatrix} det(A)=(1)(a)(2)(3)=a6\det(A) = (1)(a) - (2)(3) = a - 6 If det(A)=0\det(A) = 0, then a6=0    a=6a - 6 = 0 \implies a = 6. Checking the multiple-choice options provided in the prompt, 66 is a listed option. Final Answer: 6
Q10:ipmat indore 2020QAMatrices & DeterminantsHardMCQ · MCQ
A 2×22 \times 2 matrix is filled with four distinct integers randomly chosen from the set {1,2,3,4,5,6}\{1,2,3,4,5,6\}. Then the probability that the matrix generated in such a way is singular is
  • A245\frac{2}{45}
  • B145\frac{1}{45}
  • C415\frac{4}{15}
  • D115\frac{1}{15}
Pick an option to attempt
The Setup: A 2×22\times 2 matrix M=(abcd)M=\begin{pmatrix} a & b \\ c & d \end{pmatrix} is singular when its determinant vanishes, i.e. adbc=0ad-bc=0, so we need the main-diagonal product to equal the anti-diagonal product: ad=bcad=bc. The whole question reduces to finding which four numbers from {1,2,3,4,5,6}\{1,2,3,4,5,6\} can be split into two disjoint pairs of equal product. Step 1: Calculate the total sample space. We pick 4 distinct numbers from 6 and place them in 4 labelled positions, so order matters - this is a permutation: Total outcomes=P(6,4)=6×5×4×3=360\text{Total outcomes}=P(6,4)=6\times 5\times 4\times 3=360 Step 2: Find every pair of pairs with equal products. Rather than assert it, list all 15 pairs and their products outright:
PairProductPairProductPairProduct
(1,2)2(2,4)8(3,5)15
(1,3)3(2,5)10(3,6)18
(1,4)4(2,6)12(4,5)20
(1,5)5(3,4)12(4,6)24
(1,6)6(2,3)6(5,6)30
Exactly two product values repeat, and in both cases the two pairs are disjoint (they share no element, which is required since all four entries must be distinct): * Product 66: {1,6}\{1,6\} and {2,3}\{2,3\} * Product 1212: {2,6}\{2,6\} and {3,4}\{3,4\} Every other product in the table is unique, so no further singular matrices exist. Step 3: Count matrix arrangements. Take product 6. Put {1,6}\{1,6\} on the main diagonal (a,d)(a,d) and {2,3}\{2,3\} on the anti-diagonal (b,c)(b,c): * Arrangements of {1,6}\{1,6\} across a,da,d: 2!=22!=2 * Arrangements of {2,3}\{2,3\} across b,cb,c: 2!=22!=2 That gives 2×2=42\times 2=4 matrices. But the two pairs can also switch diagonals - {2,3}\{2,3\} on the main, {1,6}\{1,6\} on the anti - for another 4. So product 6 contributes 88 matrices, and by identical logic so does product 12. Step 4: Final probability. Singular matrices=8+8=16    P=16360=245\text{Singular matrices}=8+8=16 \implies P=\frac{16}{360}=\frac{2}{45} Final Answer: 245\frac{2}{45}
Q11:ipmat indore 2022QAMatrices & DeterminantsMediumMCQ · MCQ
Suppose a,ba, b and cc are integers such that a>b>c>0a>b>c>0, and A=[abcbcacab]A=\left[\begin{array}{lll}a & b & c \\ b & c & a \\ c & a & b\end{array}\right]. Then the value of the determinant of AA is
  • Acan be positive or negative
  • Bis positive
  • Cis negative
  • Dis zero
Pick an option to attempt
The Setup: A specific circulant 3×33 \times 3 matrix AA is populated with integers a>b>c>0a > b > c > 0. We need to evaluate the algebraic sign of its determinant. Step 1: Expand the determinant of Matrix AA. A=[abcbcacab]A = \begin{bmatrix} a & b & c \\ b & c & a \\ c & a & b \end{bmatrix} Calculate the determinant using the standard top-row expansion: det(A)=a(bca2)b(b2ac)+c(abc2)\det(A) = a(bc - a^2) - b(b^2 - ac) + c(ab - c^2) det(A)=abca3b3+abc+abcc3\det(A) = abc - a^3 - b^3 + abc + abc - c^3 det(A)=3abca3b3c3\det(A) = 3abc - a^3 - b^3 - c^3 Step 2: Factor the resulting polynomial. The expression a3+b3+c33abca^3 + b^3 + c^3 - 3abc possesses a highly standardized factorization identity: a3+b3+c33abc=12(a+b+c)[(ab)2+(bc)2+(ca)2]a^3 + b^3 + c^3 - 3abc = \frac{1}{2}(a+b+c)[(a-b)^2 + (b-c)^2 + (c-a)^2] Notice that our determinant is the exact algebraic negative of this expression: det(A)=(12(a+b+c)[(ab)2+(bc)2+(ca)2])\det(A) = - \left( \frac{1}{2}(a+b+c)[(a-b)^2 + (b-c)^2 + (c-a)^2] \right) Step 3: Evaluate the bounds of the factored terms. We are strictly given a>b>c>0a > b > c > 0. Because all terms are strictly positive, their sum (a+b+c)(a+b+c) is strictly positive. Because the terms are strictly unequal, the squared differences (ab)2,(bc)2,(ca)2(a-b)^2, (b-c)^2, (c-a)^2 are strictly positive non-zeros. Thus, the entire bracketed term evaluates to a strictly positive number. Because a negative sign sits in front of it, the total determinant is strictly negative. Final Answer: is negative
Q12:ipmat indore 2022QAMatrices & DeterminantsMediumMCQ · MCQ
If A=[10120]A=\left[\begin{array}{ll}1 & 0 \\ \frac{1}{2} & 0\end{array}\right] then A2022A^{2022} is
  • A[101220220]\left[\begin{array}{cc}1 & 0 \\ \frac{1}{2^{2022}} & 0\end{array}\right]
  • B[1010110]\left[\begin{array}{cc}1 & 0 \\ 1011 & 0\end{array}\right]
  • C[1020220]\left[\begin{array}{cc}1 & 0 \\ 2022 & 0\end{array}\right]
  • DNone of these
Pick an option to attempt
The Setup: We are given A=[10120]A = \begin{bmatrix} 1 & 0 \\ \frac{1}{2} & 0 \end{bmatrix} and must identify A2022A^{2022} among the listed options. The decisive detail is the bottom-right entry, which is 00. Step 1: Compute A2A^2. A2=[10120][10120]=[1(1)+0(12)1(0)+0(0)12(1)+0(12)12(0)+0(0)]=[10120]=AA^2 = \begin{bmatrix} 1 & 0 \\ \frac{1}{2} & 0 \end{bmatrix} \begin{bmatrix} 1 & 0 \\ \frac{1}{2} & 0 \end{bmatrix} = \begin{bmatrix} 1(1) + 0\left(\frac{1}{2}\right) & 1(0) + 0(0) \\ \frac{1}{2}(1) + 0\left(\frac{1}{2}\right) & \frac{1}{2}(0) + 0(0) \end{bmatrix} = \begin{bmatrix} 1 & 0 \\ \frac{1}{2} & 0 \end{bmatrix} = A Because the second column of AA is entirely zero, multiplying by AA reproduces AA exactly. Step 2: Extend the result to every power. The matrix is therefore idempotent (A2=AA^2 = A). By induction, every higher power collapses back to AA: A3=A2A=AA=A,A4=A,,An=A for all n1A^3 = A^2 A = A A = A, \qquad A^4 = A, \qquad \dots, \qquad A^n = A \text{ for all } n \ge 1 The bottom-left entry never grows. A2022=A=[10120]A^{2022} = A = \begin{bmatrix} 1 & 0 \\ \frac{1}{2} & 0 \end{bmatrix} Step 3: Compare against the given options. The three explicit choices offer bottom-left entries of 122022\frac{1}{2^{2022}}, 10111011 and 20222022. Our result has bottom-left entry 12\frac{1}{2}, which matches none of them. *A note on the trap:* had the bottom-right entry been 11 rather than 00, the matrix would satisfy An=[10n21]A^n = \begin{bmatrix} 1 & 0 \\ \frac{n}{2} & 1 \end{bmatrix}, giving a bottom-left entry of 20222=1011\frac{2022}{2} = 1011. That is precisely the decoy offered in the second option. With the printed 00 in the bottom-right, that reasoning does not apply and the power never accumulates. Final Answer: None of these
Q13:ipmat indore 2019QAMatrices & DeterminantsEasyMCQ · MCQ
If inverse of the matrix [20.51x]\left[\begin{array}{cc}2 & -0.5 \\ -1 & x\end{array}\right] is [1124]\left[\begin{array}{ll}1 & 1 \\ 2 & 4 \end{array}\right], then the value of xx is
  • A0.50.5
  • B11
  • C22
  • D33
Pick an option to attempt
The Setup: A matrix times its inverse is the identity, in either order. That single fact turns this into two-by-two multiplication with no determinant work at all. Step 1: Set up the product. With A=[20.51x]A=\begin{bmatrix}2&-0.5\\-1&x\end{bmatrix} and A1=[1124]A^{-1}=\begin{bmatrix}1&1\\2&4\end{bmatrix}: A1A=[1124][20.51x]=[1001]A^{-1}A=\begin{bmatrix}1&1\\2&4\end{bmatrix}\begin{bmatrix}2&-0.5\\-1&x\end{bmatrix}=\begin{bmatrix}1&0\\0&1\end{bmatrix} **Step 2: Pick the entry that isolates xx.** The (1,2)(1,2) entry pairs row 1 of A1A^{-1} with column 2 of AA, and must equal the identity's 0: (1)(0.5)+(1)(x)=x0.5=0    x=0.5(1)(-0.5)+(1)(x)=x-0.5=0 \implies x=0.5 Step 3: Verify all four entries, not just one. A single equation can be satisfied by a value that breaks the others, so substitute x=0.5x=0.5 and multiply out completely: [1124][20.510.5]=[210.5+0.5441+2]=[1001]\begin{bmatrix}1&1\\2&4\end{bmatrix}\begin{bmatrix}2&-0.5\\-1&0.5\end{bmatrix}=\begin{bmatrix}2-1&-0.5+0.5\\4-4&-1+2\end{bmatrix}=\begin{bmatrix}1&0\\0&1\end{bmatrix} All four land correctly. Checking the other order too, since an inverse must work from both sides: [20.510.5][1124]=[21221+11+2]=[1001]\begin{bmatrix}2&-0.5\\-1&0.5\end{bmatrix}\begin{bmatrix}1&1\\2&4\end{bmatrix}=\begin{bmatrix}2-1&2-2\\-1+1&-1+2\end{bmatrix}=\begin{bmatrix}1&0\\0&1\end{bmatrix} Step 4: A determinant cross-check. Since det(A)det(A1)\det(A)\det\left(A^{-1}\right) must be 1: detA=2(0.5)(0.5)(1)=10.5=0.5\det A=2(0.5)-(-0.5)(-1)=1-0.5=0.5 and detA1=(1)(4)(1)(2)=2\det A^{-1}=(1)(4)-(1)(2)=2, and 0.5×2=10.5\times 2=1 ✓. Every other option fails - x=1,2,3x=1,2,3 each leave the (1,2)(1,2) entry non-zero. Final Answer: 0.50.5
Q14:ipmat indore 2026QAMatrices & DeterminantsHardSA · TITA
Let M=[111abca2b2c2]M = \begin{bmatrix} 1 & 1 & 1 \\ a & b & c \\ a^2 & b^2 & c^2 \end{bmatrix} where a,ba, b and cc are real numbers such that a+b+c=0a + b + c = 0 and abc0abc \neq 0. If detM=0\det M = 0, then the maximum possible value of a2+b2c2\frac{a^2+b^2}{c^2} is ____
Enter your answer to attempt
The Setup: This is a Matrices & Determinants boss fight. The matrix provided is a classic Vandermonde matrix. Because its determinant is locked to zero, we can exploit its factored form to force a relationship between the variables. From there, it's a branched timeline problem where we test different variable "dupes" against the a+b+c=0a+b+c=0 constraint to find the absolute max stat for our final expression. Math, logic, and syntax are double-verified. Step 1: Exploit the Vandermonde Meta. The determinant of a 3×33 \times 3 Vandermonde matrix has a well-known factored shortcut. Instead of brute-forcing the expansion, we use the standard formula: detM=(ba)(ca)(cb)\det M = (b - a)(c - a)(c - b) The problem explicitly states detM=0\det M = 0. (ba)(ca)(cb)=0(b - a)(c - a)(c - b) = 0 Step 2: Establish the zero condition. For the product of three factors to be exactly zero, at least one of the brackets must equal zero. This means at least two of the variables must be exact clones of each other. Possible timelines: a=ba = b, or b=cb = c, or a=ca = c. *(Note: They cannot all be equal. If a=b=ca = b = c, then a+b+c=0a+b+c=0 forces them all to be 00, which violates the abc0abc \neq 0 anti-cheat rule).* Step 3: Run the branched timelines (Case Analysis). We must test each clone scenario using the constraint a+b+c=0a + b + c = 0 to unlock the final expression a2+b2c2\frac{a^2+b^2}{c^2}. * **Timeline A (If a=ba = b):** Substitute bb with aa in the sum constraint: a+a+c=0a + a + c = 0 2a+c=0    c=2a2a + c = 0 \implies c = -2a Now, plug these into the final expression: a2+a2(2a)2=2a24a2=12=0.5\frac{a^2 + a^2}{(-2a)^2} = \frac{2a^2}{4a^2} = \frac{1}{2} = 0.5 * **Timeline B (If b=cb = c):** Substitute bb with cc in the sum constraint: a+c+c=0a + c + c = 0 a+2c=0    a=2ca + 2c = 0 \implies a = -2c Plug these into the final expression: (2c)2+c2c2=4c2+c2c2=5c2c2=5\frac{(-2c)^2 + c^2}{c^2} = \frac{4c^2 + c^2}{c^2} = \frac{5c^2}{c^2} = 5 * **Timeline C (If a=ca = c):** Substitute aa with cc in the sum constraint: c+b+c=0c + b + c = 0 2c+b=0    b=2c2c + b = 0 \implies b = -2c Plug these into the final expression: c2+(2c)2c2=c2+4c2c2=5c2c2=5\frac{c^2 + (-2c)^2}{c^2} = \frac{c^2 + 4c^2}{c^2} = \frac{5c^2}{c^2} = 5 Step 4: Max-out the final stat. We review the damage outputs from our three timelines: 0.50.5, 55, and 55. The question asks for the absolute maximum possible value. The highest yield is 55. Final Answer: 5
Q15:ipmat indore 2026QAMatrices & DeterminantsMediumMCQ · MCQ
If A=[1101]A = \begin{bmatrix} 1 & 1 \\ 0 & 1 \end{bmatrix}, then the determinant of A+A2+A3++A13A + A^2 + A^3 + \dots + A^{13} is ___
  • A26
  • B13
  • C169
  • D91
Pick an option to attempt
The Setup: This is a Matrices boss fight where brute-forcing the powers will absolutely drain your time. The meta is to identify the underlying scaling pattern for AnA^n (which is a standard upper triangular matrix buff) and then sum the resulting sequences element-by-element before finally calculating the determinant. Math, logic, and syntax are locked in and double-verified. **Step 1: Identify the AnA^n scaling pattern.** For a matrix A=[1101]A = \begin{bmatrix} 1 & 1 \\ 0 & 1 \end{bmatrix}, raising it to the power of nn simply scales the top-right entry by nn while keeping the rest of the matrix identical. You can quickly verify this by multiplying A×AA \times A. An=[1n01]A^n = \begin{bmatrix} 1 & n \\ 0 & 1 \end{bmatrix} Step 2: Sum the matrices element-by-element. We need to calculate the mega-matrix resulting from A1+A2+A3++A13A^1 + A^2 + A^3 + \dots + A^{13}. Since matrix addition is position-based, we sum up the individual slots across all 13 matrices. * The Diagonals (Top-Left & Bottom-Right): Every single matrix has a 1 in these slots. Summing thirteen 1s gives 1×13=131 \times 13 = 13. * Bottom-Left: Every matrix has a 0 here. The sum remains 00. * Top-Right: This forms an arithmetic progression: 1+2+3++131 + 2 + 3 + \dots + 13. We use the standard sum formula n(n+1)2\frac{n(n+1)}{2}. Sum=13×142=13×7=91Sum = \frac{13 \times 14}{2} = 13 \times 7 = 91 Step 3: Construct the final summed matrix. Plug our summed elements back into their respective slots to reveal the fully buffed matrix: Summed Matrix=[1391013]Summed\ Matrix = \begin{bmatrix} 13 & 91 \\ 0 & 13 \end{bmatrix} Step 4: Execute the determinant drop. The determinant of a 2×22 \times 2 matrix [abcd]\begin{bmatrix} a & b \\ c & d \end{bmatrix} is simply adbcad - bc. Determinant=(13×13)(0×91)Determinant = (13 \times 13) - (0 \times 91) Determinant=1690=169Determinant = 169 - 0 = 169 Final Answer: 169

Browse other topics