Past Year QuestionsIPMAT IndoreQATrigonometry

IPMAT Indore Trigonometry — PYPs

11 solved Trigonometry previous year questions (PYQs) from IPMAT Indore past year papers — attempt each and check the answer.

Free SolutionsNo Login11 Questions
Q1:ipmat indore 2022QATrigonometryHardSA · TITA
If sinα+sinβ=23\sin \alpha+\sin \beta=\frac{\sqrt{2}}{\sqrt{3}} and cosα+cosβ=13\cos \alpha+\cos \beta=\frac{1}{\sqrt{3}}, then the value of (20cos(αβ2))2\left(20 \cos \left(\frac{\alpha-\beta}{2}\right)\right)^{2} is _________.
Enter your answer to attempt
The Setup: We are given constraint equations sinα+sinβ=23\sin\alpha+\sin\beta = \frac{\sqrt{2}}{\sqrt{3}} and cosα+cosβ=13\cos\alpha+\cos\beta = \frac{1}{\sqrt{3}}. We need to evaluate the compound trigonometric expression (20cos(αβ2))2\left(20\cos\left(\frac{\alpha-\beta}{2}\right)\right)^2. Step 1: Square and add the two primary equations. Equation 1: (sinα+sinβ)2=(23)2    sin2α+sin2β+2sinαsinβ=23(\sin\alpha+\sin\beta)^2 = \left(\frac{\sqrt{2}}{\sqrt{3}}\right)^2 \implies \sin^2\alpha + \sin^2\beta + 2\sin\alpha\sin\beta = \frac{2}{3} Equation 2: (cosα+cosβ)2=(13)2    cos2α+cos2β+2cosαcosβ=13(\cos\alpha+\cos\beta)^2 = \left(\frac{1}{\sqrt{3}}\right)^2 \implies \cos^2\alpha + \cos^2\beta + 2\cos\alpha\cos\beta = \frac{1}{3} Summing them together: (sin2α+cos2α)+(sin2β+cos2β)+2(cosαcosβ+sinαsinβ)=23+13(\sin^2\alpha + \cos^2\alpha) + (\sin^2\beta + \cos^2\beta) + 2(\cos\alpha\cos\beta + \sin\alpha\sin\beta) = \frac{2}{3} + \frac{1}{3} Using Pythagorean and subtraction identities: 1+1+2cos(αβ)=1    2+2cos(αβ)=11 + 1 + 2\cos(\alpha-\beta) = 1 \implies 2 + 2\cos(\alpha-\beta) = 1 Step 2: Relate the expression to the half-angle formula. Factor out the 22: 2(1+cos(αβ))=12(1 + \cos(\alpha-\beta)) = 1 Apply the power-reduction identity 1+cosθ=2cos2(θ2)1 + \cos\theta = 2\cos^2\left(\frac{\theta}{2}\right): 2(2cos2(αβ2))=12 \left(2\cos^2\left(\frac{\alpha-\beta}{2}\right)\right) = 1 4cos2(αβ2)=14\cos^2\left(\frac{\alpha-\beta}{2}\right) = 1 Step 3: Evaluate the target expression. The target is (20cos(αβ2))2\left(20\cos\left(\frac{\alpha-\beta}{2}\right)\right)^2. Expand the target: 400cos2(αβ2)400\cos^2\left(\frac{\alpha-\beta}{2}\right) Substitute the derived identity block: 100×[4cos2(αβ2)]=100×1=100100 \times \left[4\cos^2\left(\frac{\alpha-\beta}{2}\right)\right] = 100 \times 1 = 100 Final Answer: 100
Q2:ipmat indore 2019QATrigonometryHardSA · TITA
The number of pairs (x,y)(x, y) satisfying the equation sinx+siny=sin(x+y)\sin x + \sin y = \sin(x + y) and x+y=1|x| + |y| = 1 is
Enter your answer to attempt
The Setup: A trigonometric boss phase. Factor the first equation with sum-to-product identities to expose its root conditions, then run those through the absolute-value geometry of x+y=1|x|+|y|=1 to see which survive. Step 1: Expand and factor. Sum-to-product on the left, double angle on the right: 2sin(x+y2)cos(xy2)=2sin(x+y2)cos(x+y2)2\sin\left(\frac{x+y}{2}\right)\cos\left(\frac{x-y}{2}\right)=2\sin\left(\frac{x+y}{2}\right)\cos\left(\frac{x+y}{2}\right) Bring everything to one side and pull out the common factor: 2sin(x+y2)[cos(xy2)cos(x+y2)]=02\sin\left(\frac{x+y}{2}\right)\left[\cos\left(\frac{x-y}{2}\right)-\cos\left(\frac{x+y}{2}\right)\right]=0 Apply cosAcosB=2sin(A+B2)sin(BA2)\cos A-\cos B=2\sin\left(\frac{A+B}{2}\right)\sin\left(\frac{B-A}{2}\right) to the bracket, with A=xy2A=\frac{x-y}{2} and B=x+y2B=\frac{x+y}{2}, so that A+B2=x2\frac{A+B}{2}=\frac{x}{2} and BA2=y2\frac{B-A}{2}=\frac{y}{2}: 4sin(x2)sin(y2)sin(x+y2)=04\sin\left(\frac{x}{2}\right)\sin\left(\frac{y}{2}\right)\sin\left(\frac{x+y}{2}\right)=0 Step 2: Identify the root scenarios. A product is zero only if a factor is, giving three parallel timelines: sin(x2)=0    x=2nπ,sin(y2)=0    y=2nπ,sin(x+y2)=0    x+y=2nπ\sin\left(\frac{x}{2}\right)=0\implies x=2n\pi, \qquad \sin\left(\frac{y}{2}\right)=0\implies y=2n\pi, \qquad \sin\left(\frac{x+y}{2}\right)=0\implies x+y=2n\pi Step 3: Apply the domain constraint. On x+y=1|x|+|y|=1 we have x1|x|\leq 1, y1|y|\leq 1, and by the triangle inequality x+yx+y=1|x+y|\leq|x|+|y|=1. Since 2π6.282\pi\approx 6.28 is far outside that, **only n=0n=0 survives** in all three families, collapsing them to x=0x=0, y=0y=0, or x+y=0x+y=0. Step 4: Hunt the coordinates. Intersect each line with the diamond x+y=1|x|+|y|=1: * x=0    y=1x=0 \implies |y|=1: gives (0,1)(0,1) and (0,1)(0,-1) * y=0    x=1y=0 \implies |x|=1: gives (1,0)(1,0) and (1,0)(-1,0) * x=y    2x=1x=-y \implies 2|x|=1: gives (12,12)\left(\tfrac{1}{2},-\tfrac{1}{2}\right) and (12,12)\left(-\tfrac{1}{2},\tfrac{1}{2}\right) Step 5: Check for double-counting before adding. The only point that could belong to two of these lines is (0,0)(0,0), where x=0x=0 and y=0y=0 meet - but it fails x+y=1|x|+|y|=1, so it never enters the list. The six points above are pairwise distinct, and the count is genuinely 2+2+22+2+2. Final Answer: 6
Q3:ipmat indore 2020QATrigonometryHardMCQ · MCQ
The value of cos2(π8)+cos2(3π8)+cos2(5π8)+cos2(7π8)\cos^2\left(\frac{\pi}{8}\right) + \cos^2\left(\frac{3\pi}{8}\right) + \cos^2\left(\frac{5\pi}{8}\right) + \cos^2\left(\frac{7\pi}{8}\right) is
  • A11
  • B32\frac{3}{2}
  • C22
  • D94\frac{9}{4}
Pick an option to attempt
The Setup: This trig expression looks intimidating, but it has zero plot armour once you spot the symmetry in the angles. We use the supplementary angle identity to fold the expression in half, then the complementary identity to finish it off. Step 1: Fold the back half. Notice that 7π8=ππ8\frac{7\pi}{8}=\pi-\frac{\pi}{8}, and cos(πθ)=cosθ\cos(\pi-\theta)=-\cos\theta, so cos(7π8)=cos(π8)\cos\left(\frac{7\pi}{8}\right)=-\cos\left(\frac{\pi}{8}\right). Squaring kills the minus sign: cos2(7π8)=cos2(π8)\cos^2\left(\frac{7\pi}{8}\right)=\cos^2\left(\frac{\pi}{8}\right) Identically, 5π8=π3π8\frac{5\pi}{8}=\pi-\frac{3\pi}{8}, so cos2(5π8)=cos2(3π8)\cos^2\left(\frac{5\pi}{8}\right)=\cos^2\left(\frac{3\pi}{8}\right). Step 2: Simplify the sum. The four terms collapse into two identical pairs: 2[cos2(π8)+cos2(3π8)]2\left[\cos^2\left(\frac{\pi}{8}\right)+\cos^2\left(\frac{3\pi}{8}\right)\right] Step 3: Exploit the complementary angles. Notice that π8+3π8=4π8=π2\frac{\pi}{8}+\frac{3\pi}{8}=\frac{4\pi}{8}=\frac{\pi}{2}. The two angles are complementary, and cos(π2θ)=sinθ\cos\left(\frac{\pi}{2}-\theta\right)=\sin\theta, so: cos(3π8)=sin(π8)\cos\left(\frac{3\pi}{8}\right)=\sin\left(\frac{\pi}{8}\right) Step 4: Use the legendary identity. Substitute sine into the folded expression: 2[cos2(π8)+sin2(π8)]2\left[\cos^2\left(\frac{\pi}{8}\right)+\sin^2\left(\frac{\pi}{8}\right)\right] By the Pythagorean identity cos2θ+sin2θ=1\cos^2\theta+\sin^2\theta=1, the bracket collapses to 1: 2×1=22\times 1=2 Final Answer: 22
Q4:ipmat indore 2021QATrigonometryMediumMCQ · MCQ
If the angles A,B,CA, B, C of a triangle are in arithmetic progression such that sin(2A+B)=1/2\sin(2A + B) = 1/2 then sin(B+2C)\sin(B + 2C) is equal to
  • A12\frac{-1}{2}
  • B12\frac{1}{2}
  • C12\frac{-1}{\sqrt{2}}
  • D32\frac{3}{\sqrt{2}}
Pick an option to attempt
The Setup: Geometry meets Trigonometry. The angles of a triangle always sum to 180180^\circ. If they are in an Arithmetic Progression, the middle angle acts as the perfect average, completely locking in its value from the start. Step 1: Find angle BB. Since AA, BB, CC are in AP: A+C=2BA+C=2B Substitute this into the triangle angle sum theorem: A+B+C=180    2B+B=180    3B=180    B=60A+B+C=180^\circ \implies 2B+B=180^\circ \implies 3B=180^\circ \implies B=60^\circ Step 2: Use the sine condition to find angle AA. We know sin(2A+B)=1/2\sin(2A+B)=1/2. Since A+C=120A+C=120^\circ, angle AA is stuck below 120120^\circ, so 2A+602A+60^\circ never climbs past 300300^\circ - that leaves exactly two candidates, 3030^\circ and 150150^\circ. * If 2A+60=30    2A=302A+60^\circ=30^\circ \implies 2A=-30^\circ (Angles in a triangle must be positive, so this is a wipe). * If 2A+60=150    2A=90    A=452A+60^\circ=150^\circ \implies 2A=90^\circ \implies A=45^\circ. Step 3: Find angle CC. C=180(A+B)=180(45+60)=75C=180^\circ-(A+B)=180^\circ-(45^\circ+60^\circ)=75^\circ Step 4: Plug the stats into the final equation sin(B+2C)\sin(B+2C). B+2C=60+2(75)=60+150=210B+2C=60^\circ+2(75^\circ)=60^\circ+150^\circ=210^\circ sin(210)=sin(180+30)=sin(30)=12\sin(210^\circ)=\sin(180^\circ+30^\circ)=-\sin(30^\circ)=-\frac{1}{2} Final Answer: 12\frac{-1}{2}
Q5:ipmat indore 2022QATrigonometryHardMCQ · MCQ
For 0<θ<π40\lt\theta\lt\frac{\pi}{4}, let a=((sinθ)sinθ)(log2cosθ),b=((cosθ)sinθ)(log2sinθ),c=((sinθ)cosθ)(log2cosθ)a=\left((\sin \theta)^{\sin \theta}\right)\left(\log _{2} \cos \theta\right), b=\left((\cos \theta)^{\sin \theta}\right)\left(\log _{2} \sin \theta\right), c=\left((\sin \theta)^{\cos \theta}\right)\left(\log _{2} \cos \theta\right) and d=((sinθ)sinθ)(log2sinθ)d=\left((\sin \theta)^{\sin \theta}\right)\left(\log _{2} \sin \theta\right). Then, the median value in the sequence a,b,c,da, b, c, d is
  • Aa+b2\frac{a+b}{2}
  • Ba+d2\frac{a+d}{2}
  • Cb+c2\frac{b+c}{2}
  • Dc+d2\frac{c+d}{2}
Pick an option to attempt
The Setup: We are asked to order four logarithmic-exponential expressions to find their median. By analyzing the base and arguments within the interval 0<θ<π/40 < \theta < \pi/4, we can determine their strict mathematical ordering. Step 1: Analyze the components within the given domain. For θ(0,π/4)\theta \in (0, \pi/4), the sine and cosine functions are bounded such that: 0<sinθ<12<cosθ<10 < \sin\theta < \frac{1}{\sqrt{2}} < \cos\theta < 1 Because both sinθ\sin\theta and cosθ\cos\theta are strictly between 00 and 11, their base-22 logarithms are strictly negative: log2(sinθ)<log2(cosθ)<0\log_2(\sin\theta) < \log_2(\cos\theta) < 0 Step 2: Compare the components of expressions a,b,c,da, b, c, d. The definitions are: a=(sinθ)sinθlog2(cosθ)a = (\sin\theta)^{\sin\theta} \log_2(\cos\theta) b=(cosθ)sinθlog2(sinθ)b = (\cos\theta)^{\sin\theta} \log_2(\sin\theta) c=(sinθ)cosθlog2(cosθ)c = (\sin\theta)^{\cos\theta} \log_2(\cos\theta) d=(sinθ)sinθlog2(sinθ)d = (\sin\theta)^{\sin\theta} \log_2(\sin\theta) Notice that all four overall expressions yield negative values (a positive exponential multiplied by a negative logarithm). Step 3: Establish the inequalities. First, compare aa and cc: Since sinθ<cosθ\sin\theta < \cos\theta and the base sinθ(0,1)\sin\theta \in (0, 1), a larger exponent yields a smaller value: (sinθ)cosθ<(sinθ)sinθ(\sin\theta)^{\cos\theta} < (\sin\theta)^{\sin\theta} Because log2(cosθ)\log_2(\cos\theta) is negative, multiplying both sides by it reverses the inequality: (sinθ)cosθlog2(cosθ)>(sinθ)sinθlog2(cosθ)    c>a(\sin\theta)^{\cos\theta} \log_2(\cos\theta) > (\sin\theta)^{\sin\theta} \log_2(\cos\theta) \implies c > a Second, compare bb and dd: Because sinθ<cosθ\sin\theta < \cos\theta, raising them to the positive power of sinθ\sin\theta preserves the inequality: (sinθ)sinθ<(cosθ)sinθ(\sin\theta)^{\sin\theta} < (\cos\theta)^{\sin\theta} Because log2(sinθ)\log_2(\sin\theta) is negative, multiplying reverses the inequality: (sinθ)sinθlog2(sinθ)>(cosθ)sinθlog2(sinθ)    d>b(\sin\theta)^{\sin\theta} \log_2(\sin\theta) > (\cos\theta)^{\sin\theta} \log_2(\sin\theta) \implies d > b Third, compare aa and dd: They share the identical positive exponential factor (sinθ)sinθ(\sin\theta)^{\sin\theta}. Since log2(sinθ)<log2(cosθ)\log_2(\sin\theta) < \log_2(\cos\theta), multiplying by the positive exponential preserves the inequality: d<ad < a Step 4: Determine the median. Combining the inequalities gives the strict ascending order: b<d<a<cb < d < a < c. For a set of 4 elements, the median is the arithmetic mean of the two central terms (dd and aa). Median=a+d2\text{Median} = \frac{a + d}{2} Final Answer: a+d2\frac{a+d}{2}
Q6:ipmat indore 2021QATrigonometryMediumMCQ · MCQ
The set of all real value of pp for which the equation 3sin2x+12cosx3=p3 \sin^2x + 12 \cos x - 3 = p has at least one solution is
  • A[12,12][-12, 12]
  • B[12,9][-12, 9]
  • C[15,9][-15, 9]
  • D[15,12][-15, 12]
Pick an option to attempt
The Setup: We are converting a trig equation into a standard quadratic to find its absolute range (the min and max values of pp). Since the equation involves both sine and cosine, we use the identity sin2x=1cos2x\sin^2x=1-\cos^2x to unify the variables. Step 1: Substitute and simplify the expression. Let f(x)=pf(x)=p. 3(1cos2x)+12cosx3=p3(1-\cos^2x)+12\cos x-3=p 33cos2x+12cosx3=p3-3\cos^2x+12\cos x-3=p 3cos2x+12cosx=p-3\cos^2x+12\cos x=p Step 2: Set up a boundary replacement. Let t=cosxt=\cos x. Because of the constraints of the cosine function, tt is strictly bounded: t[1,1]t\in[-1,1]. Our new function is g(t)=3t2+12tg(t)=-3t^2+12t. We need the absolute min and max of this quadratic on the locked interval [1,1][-1,1]. Step 3: Find the vertex of the parabola. For a quadratic at2+bt+cat^2+bt+c, the vertex occurs at t=b/(2a)t=-b/(2a). t=122(3)=126=2t=\frac{-12}{2(-3)}=\frac{-12}{-6}=2 The vertex sits at t=2t=2, which is completely outside our playable zone of [1,1][-1,1]. Because it's a downward-opening parabola (negative aa), it is strictly increasing across our entire [1,1][-1,1] interval. Step 4: Test the boundaries to find the range. * If t=1t=-1 (Minimum): g(1)=3(1)2+12(1)=312=15g(-1)=-3(-1)^2+12(-1)=-3-12=-15. * If t=1t=1 (Maximum): g(1)=3(1)2+12(1)=3+12=9g(1)=-3(1)^2+12(1)=-3+12=9. The function seamlessly spans every value between these two extremes. Final Answer: [15,9][-15, 9]
Q7:ipmat indore 2022QATrigonometryMediumMCQ · MCQ
Ayesha is standing atop a vertical tower 200m200 m high and observes a car moving away from the tower on a straight, horizontal road from the foot of the tower. At 11:00 AM, she observes the angle of depression of the car to be 4545^{\circ}. At 11:02 AM, she observes the angle of depression of the car to be 3030^{\circ}. The speed at which the car is moving is approximately
  • A6.3 km per hour
  • B8.45 km per hour
  • C10.6 km per hour
  • D4.39 km per hour
Pick an option to attempt
The Setup: A car is tracked from a 200m200\text{m} tower. Its angle of depression changes from 4545^\circ to 3030^\circ over exactly 22 minutes. We must use right-triangle trigonometry to find its speed in km/h\text{km/h}. Step 1: Calculate the initial horizontal distance. Let the tower base be the origin. At 11:00 AM, the angle of depression is 4545^\circ. Using trigonometry, tan(45)=HeightDistance1\tan(45^\circ) = \frac{\text{Height}}{\text{Distance}_1}. 1=200d1    d1=200 meters1 = \frac{200}{d_1} \implies d_1 = 200\text{ meters} Step 2: Calculate the subsequent horizontal distance. At 11:02 AM, the angle of depression is 3030^\circ. tan(30)=HeightDistance2\tan(30^\circ) = \frac{\text{Height}}{\text{Distance}_2} 13=200d2    d2=2003 meters\frac{1}{\sqrt{3}} = \frac{200}{d_2} \implies d_2 = 200\sqrt{3}\text{ meters} Step 3: Calculate the distance traveled. The distance the car traveled in the 2-minute interval is the difference: Δd=d2d1=2003200=200(31)\Delta d = d_2 - d_1 = 200\sqrt{3} - 200 = 200(\sqrt{3} - 1) Using the approximation 31.732\sqrt{3} \approx 1.732: Δd200(1.7321)=200(0.732)=146.4 meters\Delta d \approx 200(1.732 - 1) = 200(0.732) = 146.4\text{ meters} Step 4: Calculate the speed in km/h. The car traveled 146.4146.4 meters in 22 minutes. Speed=146.4 meters2 minutes=73.2 meters/minute\text{Speed} = \frac{146.4\text{ meters}}{2\text{ minutes}} = 73.2\text{ meters/minute} Convert to kilometers per hour (×60 minutes/hour,÷1000 meters/km\times 60 \text{ minutes/hour}, \div 1000 \text{ meters/km}): Speed=73.2×601000=43921000=4.392 km/h\text{Speed} = \frac{73.2 \times 60}{1000} = \frac{4392}{1000} = 4.392\text{ km/h} Final Answer: 4.39 km per hour
Q8:ipmat indore 2024QATrigonometryEasyMCQ · MCQ
The angle of elevation of the top of a pole from a point A on the ground is 30. The angle of elevation changes to 45, after moving 20 meters towards the base of the pole. Then the height of the pole, in meters, is
  • A15(5+1)15(\sqrt{5} + 1)
  • B20(3+1)20(\sqrt{3} + 1)
  • C3030
  • D10(3+1)10(\sqrt{3} + 1)
Pick an option to attempt
The Setup: This problem models two angles of elevation to the top of a pole from different horizontal distances. We use right-triangle trigonometry to build a system of linear equations mapping distance to height. Step 1: Establish the initial trigonometric relation. Let hh be the height of the pole, and xx be the initial horizontal distance from point AA to the pole's base. tan(30)=hx    13=hx    x=h3\tan(30^\circ) = \frac{h}{x} \implies \frac{1}{\sqrt{3}} = \frac{h}{x} \implies x = h\sqrt{3} Step 2: Establish the secondary trigonometric relation. After moving 2020 meters closer, the new distance is x20x - 20. tan(45)=hx20\tan(45^\circ) = \frac{h}{x - 20} Since tan(45)=1\tan(45^\circ) = 1: 1=hx20    h=x201 = \frac{h}{x - 20} \implies h = x - 20 Step 3: Substitute and solve for hh. Replace xx with h3h\sqrt{3}: h=h320h = h\sqrt{3} - 20 20=h3h=h(31)20 = h\sqrt{3} - h = h(\sqrt{3} - 1) h=2031h = \frac{20}{\sqrt{3} - 1} Step 4: Rationalize the denominator. Multiply the numerator and denominator by the conjugate (3+1)(\sqrt{3} + 1): h=20(3+1)(31)(3+1)=20(3+1)31h = \frac{20(\sqrt{3} + 1)}{(\sqrt{3} - 1)(\sqrt{3} + 1)} = \frac{20(\sqrt{3} + 1)}{3 - 1} h=20(3+1)2=10(3+1)h = \frac{20(\sqrt{3} + 1)}{2} = 10(\sqrt{3} + 1) Final Answer: 10(3+1)10(\sqrt{3}+1)
Q9:ipmat indore 2019QATrigonometryHardMCQ · MCQ
Given that cosx+cosy=1\cos x + \cos y = 1, the range of sinxsiny\sin x - \sin y is
  • A[1,1][-1, 1]
  • B[2,2][-2, 2]
  • C[0,3][0, \sqrt{3}]
  • D[3,3][-\sqrt{3}, \sqrt{3}]
Pick an option to attempt
The Setup: One equation constrains the pair (x,y)(x,y), and we want the range of a second expression. Squaring both and adding is the standard move, because the Pythagorean identity then collapses most of the terms. Step 1: Name the target. Let S=sinxsinyS=\sin x-\sin y, given cosx+cosy=1\cos x+\cos y=1. Step 2: Square both and add. (cosx+cosy)2=1    cos2x+2cosxcosy+cos2y=1(\cos x+\cos y)^2=1 \implies \cos^2x+2\cos x\cos y+\cos^2y=1 (sinxsiny)2=S2    sin2x2sinxsiny+sin2y=S2(\sin x-\sin y)^2=S^2 \implies \sin^2x-2\sin x\sin y+\sin^2y=S^2 Adding, and grouping sin2+cos2=1\sin^2+\cos^2=1 for each of xx and yy: 1+1+2(cosxcosysinxsiny)=1+S21+1+2\left(\cos x\cos y-\sin x\sin y\right)=1+S^2 The bracket is exactly the expansion of cos(x+y)\cos(x+y), so: 2+2cos(x+y)=1+S2    S2=1+2cos(x+y)2+2\cos(x+y)=1+S^2 \implies S^2=1+2\cos(x+y) **Step 3: Bound cos(x+y)\cos(x+y) using the constraint.** Sum-to-product on the given equation, writing u=x+y2u=\frac{x+y}{2} and v=xy2v=\frac{x-y}{2}: 2cosucosv=1    cosucosv=122\cos u\cos v=1 \implies \cos u\cos v=\frac{1}{2} Since cosv1|\cos v|\leq 1, we need cosu12|\cos u|\geq\frac{1}{2}, hence cos2u14\cos^2u\geq\frac{1}{4}. The double-angle formula then gives: cos(x+y)=2cos2u12141=12\cos(x+y)=2\cos^2u-1 \geq 2\cdot\frac{1}{4}-1=-\frac{1}{2} and of course cos(x+y)1\cos(x+y)\leq 1 always. Substituting into S2=1+2cos(x+y)S^2=1+2\cos(x+y): S2[11, 1+2]=[0, 3]S^2\in[\,1-1,\ 1+2\,]=[0,\ 3] Step 4: Confirm both extremes are actually reachable. Bounds are worthless unless attained, so produce explicit angles satisfying cosx+cosy=1\cos x+\cos y=1: * x=π3, y=π3x=\frac{\pi}{3},\ y=-\frac{\pi}{3}: then cosx+cosy=12+12=1\cos x+\cos y=\frac{1}{2}+\frac{1}{2}=1 ✓ and S=32(32)=3S=\frac{\sqrt{3}}{2}-\left(-\frac{\sqrt{3}}{2}\right)=\sqrt{3}, the maximum. * x=y=π3x=y=\frac{\pi}{3}: then cosx+cosy=1\cos x+\cos y=1 ✓ and S=0S=0, the minimum of S|S|. Swapping xx and yy negates SS, so 3-\sqrt{3} is reached too, and since SS varies continuously it sweeps everything between: S[3, 3]S\in\left[-\sqrt{3},\ \sqrt{3}\right] Final Answer: [3,3][-\sqrt{3}, \sqrt{3}]
Q10:ipmat indore 2019QATrigonometryHardMCQ · MCQ
If sinθ+cosθ=msin \theta + cos \theta = m, then sin6θ+cos6θsin^6 \theta + cos^6 \theta equals
  • A3(m2+1)4\frac{3(m^2+1)}{4}
  • B3(m21)4\frac{3(m^2-1)}{4}
  • C13(m21)41-\frac{3(m^2-1)}{4}
  • D13(m21)241-\frac{3(m^2-1)^2}{4}
Pick an option to attempt
The Setup: An algebraic identity wearing a trigonometry costume. We must climb from first powers to sixth powers, and the bridge is the single quantity sinθcosθ\sin\theta\cos\theta, which squaring the given equation hands us immediately. Step 1: Extract the cross-term. Square both sides: (sinθ+cosθ)2=m2    sin2θ+cos2θ+2sinθcosθ=m2(\sin\theta+\cos\theta)^2=m^2 \implies \sin^2\theta+\cos^2\theta+2\sin\theta\cos\theta=m^2 Since sin2θ+cos2θ=1\sin^2\theta+\cos^2\theta=1: 1+2sinθcosθ=m2    sinθcosθ=m2121+2\sin\theta\cos\theta=m^2 \implies \sin\theta\cos\theta=\frac{m^2-1}{2} Step 2: Reduce the sixth powers to that one quantity. Use the sum of cubes a3+b3=(a+b)(a2ab+b2)a^3+b^3=(a+b)\left(a^2-ab+b^2\right) with a=sin2θa=\sin^2\theta and b=cos2θb=\cos^2\theta: sin6θ+cos6θ=(sin2θ+cos2θ)(sin4θsin2θcos2θ+cos4θ)\sin^6\theta+\cos^6\theta=\left(\sin^2\theta+\cos^2\theta\right)\left(\sin^4\theta-\sin^2\theta\cos^2\theta+\cos^4\theta\right) The first bracket is 1. For the second, use the identity a2+b2=(a+b)22aba^2+b^2=(a+b)^2-2ab on sin4θ+cos4θ\sin^4\theta+\cos^4\theta, which turns a2ab+b2a^2-ab+b^2 into (a+b)23ab(a+b)^2-3ab: sin4θsin2θcos2θ+cos4θ=(sin2θ+cos2θ)23sin2θcos2θ=13(sinθcosθ)2\sin^4\theta-\sin^2\theta\cos^2\theta+\cos^4\theta=\left(\sin^2\theta+\cos^2\theta\right)^2-3\sin^2\theta\cos^2\theta=1-3\left(\sin\theta\cos\theta\right)^2 Step 3: Substitute. Note the cross-term gets squared, so the bracket from Step 1 is squared whole: sin6θ+cos6θ=13(m212)2=13(m21)24\sin^6\theta+\cos^6\theta=1-3\left(\frac{m^2-1}{2}\right)^2=1-\frac{3\left(m^2-1\right)^2}{4} Option 3 drops that squaring and reads 13(m21)41-\frac{3(m^2-1)}{4} - the difference is one exponent, so check it before committing. Spot-check at θ=0\theta=0: then m=sin0+cos0=1m=\sin 0+\cos 0=1, and the formula gives 13(11)24=11-\frac{3(1-1)^2}{4}=1, matching sin60+cos60=0+1=1\sin^6 0+\cos^6 0=0+1=1. Final Answer: 13(m21)241-\frac{3(m^2-1)^2}{4}
Q11:ipmat indore 2023QATrigonometryMediumMCQ · MCQ
If cosαcos \alpha + cosβcos \beta = 1 then the maximum value of sinαsinβsin \alpha - sin \beta is
  • A2\sqrt{2}
  • B22
  • C3\sqrt{3}
  • D11
Pick an option to attempt
The Setup: Given the constraint cosα+cosβ=1\cos\alpha + \cos\beta = 1, we must find the maximum value of sinαsinβ\sin\alpha - \sin\beta. Step 1: Rewrite both expressions with the sum-to-product identities. Let u=α+β2u = \frac{\alpha+\beta}{2} and v=αβ2v = \frac{\alpha-\beta}{2}. The constraint and the target expression become: cosα+cosβ=2cosucosv=1\cos\alpha + \cos\beta = 2\cos u \cos v = 1 sinαsinβ=2cosusinv\sin\alpha - \sin\beta = 2\cos u \sin v Both share the same factor 2cosu2\cos u, which is what makes the constraint substitutable. Step 2: Eliminate uu using the constraint. The constraint gives 2cosu=1cosv2\cos u = \frac{1}{\cos v} directly (note cosv0\cos v \neq 0). Substitute this into the target: sinαsinβ=(1cosv)sinv=tanv\sin\alpha - \sin\beta = \left(\frac{1}{\cos v}\right)\sin v = \tan v The whole problem has collapsed to maximising tanv\tan v. Step 3: Find the admissible range of vv. cosu\cos u is a cosine, so it is bounded by cosu1|\cos u| \le 1: 12cosv1    cosv12\left|\frac{1}{2\cos v}\right| \le 1 \implies |\cos v| \ge \frac{1}{2} On the branch where tanv\tan v is positive and increasing, this restricts vv to 0vπ30 \le v \le \frac{\pi}{3}. Step 4: Maximise on that range. tanv\tan v increases throughout [0,π3]\left[0, \frac{\pi}{3}\right], so the maximum sits at the right endpoint: Maximum=tanπ3=3\text{Maximum} = \tan\frac{\pi}{3} = \sqrt{3} Step 5: Confirm the maximum is actually attained. At v=π3v = \frac{\pi}{3} the constraint forces cosu=12cos(π/3)=1\cos u = \frac{1}{2\cos(\pi/3)} = 1, so u=0u = 0, giving α=π3\alpha = \frac{\pi}{3} and β=π3\beta = -\frac{\pi}{3}. Check both conditions: cosπ3+cos(π3)=12+12=1\cos\frac{\pi}{3} + \cos\left(-\frac{\pi}{3}\right) = \frac{1}{2} + \frac{1}{2} = 1 sinπ3sin(π3)=32+32=3\sin\frac{\pi}{3} - \sin\left(-\frac{\pi}{3}\right) = \frac{\sqrt{3}}{2} + \frac{\sqrt{3}}{2} = \sqrt{3} Both hold, so 3\sqrt{3} is genuinely achieved and is the maximum. Final Answer: 3\sqrt{3}

Browse other topics · IPMAT Indore